C₂₁H₂₇N (P274)
Quantities
| P2067 | mass | 293.214 |
| P233 | canonical SMILES | String | CC(C)(C)N1CCC(CC1)(C2=CC=CC=C2)C3=CC=CC=C3 | ??? |
| P373 | Commons category | String | Budipine | ??? |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q11085 (Parkinson's disease) | Parkinson's disease |
| P279 | subclass of | ... | Q193430 (heterocyclic compound) | heterocyclic compound |
| P2868 | subject has role | ... | Q3579672 (antiparkinson) | antiparkinson |
| P267 | ATC code | N04BX03 |
| P231 | CAS Registry Number | 57982-78-2 |
| P683 | ChEBI ID | 135228 |
| P592 | ChEMBL ID | CHEMBL334491 |
| P661 | ChemSpider ID | 62021 |
| P715 | DrugBank ID | DB13502 |
| P11198 | DrugCentral ID | 420 |
| P8494 | DSSTOX compound identifier | DTXCID00129200 |
| P3117 | DSSTox substance ID | DTXSID20206709 |
| P232 | EC number | 261-062-4 |
| P2566 | ECHA Substance Infocard ID | 100.055.494 |
| P646 | Freebase ID | /m/02x035z |
| P2057 | Human Metabolome Database ID | HMDB0249425 |
| P234 | InChI | InChI=1S/C21H27N/c1-20(2,3)22-16-14-21(15-17-22,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3 |
| P235 | InChIKey | QIHLUZAFSSMXHQ-UHFFFAOYSA-N |
| P665 | KEGG ID | D07306 |
| P486 | MeSH descriptor ID | C026710 |
| P6366 | Microsoft Academic ID (discontinued) | 2778215410 |
| P11199 | Probes And Drugs ID | PD073086 |
| P662 | PubChem CID | 68778 |
| P3345 | RxNorm CUI | 19832 |
| P2877 | SureChEMBL ID | 120041 |
| P11089 | UniChem compound ID | 202202 |
| P652 | UNII | L9026OPI2Z |
Why not click here or view trends?
log id: 1300900