Wikidata entity: Q2813830
C₂₁H₄₀O₄ (P274)
Quantities
| P2067 | mass | 356.29266 |
| P233 | canonical SMILES | String | CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO | ??? |
| P703 | found in taxon | ... | Q161648 (Sciadopitys verticillata) | Sciadopitys verticillata |
| P1552 | has characteristic | ... | Q1517187 (bitterness) | bitterness |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CO)CO | ??? |
| P129 | physically interacts with | ... | Q21132652 (G protein-coupled receptor 119) | G protein-coupled receptor 119 |
| P279 | subclass of | ... | Q109923912 (biogenic acyclic ester) | biogenic acyclic ester |
| P11160 | Cannabis Database ID | 000801 |
| P231 | CAS Registry Number | 3443-84-3 |
| P683 | ChEBI ID | 73990 |
| P592 | ChEMBL ID | CHEMBL3182200 |
| P661 | ChemSpider ID | 4478086 |
| P8494 | DSSTOX compound identifier | DTXCID407875 |
| P3117 | DSSTox substance ID | DTXSID8058661 |
| P646 | Freebase ID | /m/0h64yjk |
| P595 | Guide to Pharmacology Ligand ID | 5112 |
| P2057 | Human Metabolome Database ID | HMDB0011537 |
| P234 | InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| P235 | InChIKey | UPWGQKDVAURUGE-KTKRTIGZSA-N |
| P2064 | KNApSAcK ID | C00050775 |
| P2063 | LIPID MAPS ID | LMGL01010024 |
| P6366 | Microsoft Academic ID (discontinued) | 2777258945 |
| P11199 | Probes And Drugs ID | PD018141 |
| P662 | PubChem CID | 5319879 |
| P1579 | Reaxys registry number | 1728973 |
| P4964 | SPLASH | splash10-0ufr-0910000000-eae865712b7d7da1d608 |
| P2877 | SureChEMBL ID | 16172 |
| P8691 | SwissLipids ID | SLM:000389237 |
| P11089 | UniChem compound ID | 23281621 |
| P652 | UNII | 9A2389K694 |
Why not click here or view trends?
log id: 5797429