Wikidata entity: Q28529703
C₂₅H₃₈N₇O₁₇P₃S (P274)
Quantities
| P2067 | mass | 833.1279679656398 |
| P233 | canonical SMILES | String | CC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)([O-])[O-] | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P2017 | isomeric SMILES | String | CC(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)n1cnc2c(N)ncnc12 | ??? |
| P361 | part of | ... | Q21121762 (dihydrolipoyllysine-residue (2-methylpropanoyl)transferase activity) | dihydrolipoyllysine-residue (2-methylpropanoyl)transferase activity |
| P361 | part of | ... | Q22316098 (2-oxoisovalerate dehydrogenase (acylating) activity) | 2-oxoisovalerate dehydrogenase (acylating) activity |
| P361 | part of | ... | Q22316385 (3-methyl-2-oxobutanoate dehydrogenase (ferredoxin) activity) | 3-methyl-2-oxobutanoate dehydrogenase (ferredoxin) activity |
| P361 | part of | ... | Q22324048 (isobutyryl-CoA mutase activity) | isobutyryl-CoA mutase activity |
| P279 | subclass of | ... | Q107968 (anion) | anion |
| P683 | ChEBI ID | 57338 |
| P8494 | DSSTOX compound identifier | DTXCID901364028 |
| P3117 | DSSTox substance ID | DTXSID90935397 |
| P234 | InChI | InChI=1S/C25H42N7O17P3S/c1-13(2)24(37)53-8-7-27-15(33)5-6-28-22(36)19(35)25(3,4)10-46-52(43,44)49-51(41,42)45-9-14-18(48-50(38,39)40)17(34)23(47-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,34-35H,5-10H2,1-4H3,(H,27,33)(H,28,36)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/p-4/t14-,17-,18-,19+,23-/m1/s1 |
| P235 | InChIKey | AEWHYWSPVRZHCT-NDZSKPAWSA-J |
| P662 | PubChem CID | 45266570 |
| P8691 | SwissLipids ID | SLM:000389506 |
| P11089 | UniChem compound ID | 1103856 |
Why not click here or view trends?
log id: 5636689