Wikidata entity: Q304570
C₉H₆N₂O₃ (P274)
Quantities
| P4250 | defined daily dose | 1 |
| P2067 | mass | 190.038 |
| P2101 | melting point | 180 |
| P233 | canonical SMILES | String | C1=CC2=C(C=CC(=C2N=C1)O)[N+](=O)[O-] | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q221668 (urinary tract infection) | urinary tract infection |
| P636 | route of administration | ... | Q285166 (oral administration) | oral administration |
| P279 | subclass of | ... | Q17310777 (quinoline alkaloid) | quinoline alkaloid |
| P2868 | subject has role | ... | Q578726 (antifungal) | antifungal |
| P2868 | subject has role | ... | Q50377189 (urinary anti-infective agents) | urinary anti-infective agents |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | nitroxolinum | ??? |
| P267 | ATC code | J01XX07 |
| P231 | CAS Registry Number | 4008-48-4 |
| P683 | ChEBI ID | 67121 |
| P592 | ChEMBL ID | CHEMBL1454910 |
| P661 | ChemSpider ID | 18756 |
| P715 | DrugBank ID | DB01422 |
| P11198 | DrugCentral ID | 1954 |
| P8494 | DSSTOX compound identifier | DTXCID2026284 |
| P3117 | DSSTox substance ID | DTXSID4046284 |
| P232 | EC number | 223-662-4 |
| P2566 | ECHA Substance Infocard ID | 100.021.513 |
| P646 | Freebase ID | /m/02w__27 |
| P2057 | Human Metabolome Database ID | HMDB0015491 |
| P234 | InChI | InChI=1S/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H |
| P235 | InChIKey | RJIWZDNTCBHXAL-UHFFFAOYSA-N |
| P665 | KEGG ID | D07245 |
| P486 | MeSH descriptor ID | C005308 |
| P6366 | Microsoft Academic ID (discontinued) | 2776860629 |
| P9405 | NMRShiftDB structure ID | 10023347 |
| P2840 | NSC number | 74947 |
| P2840 | NSC number | 760393 |
| P3636 | PDB ligand ID | HNQ |
| P638 | PDB structure ID | 3AI8 |
| P11199 | Probes And Drugs ID | PD000164 |
| P662 | PubChem CID | 19910 |
| P3345 | RxNorm CUI | 31901 |
| P5076 | Römpp online ID | RD-14-01509 |
| P2877 | SureChEMBL ID | 151248 |
| P11089 | UniChem compound ID | 846125 |
| P652 | UNII | A8M33244M6 |
Why not click here or view trends?
log id: 2275238