Wikidata entity: Q3154065
C₃₇H₃₉IO₉ (P274)
Quantities
| P2067 | mass | 754.163881 |
| P233 | canonical SMILES | String | CC1CC2(C3C4C1(C5C=C(C(=O)C5(CC(=C4)COC(=O)CC6=CC(=C(C(=C6)I)O)OC)O)C)OC(O3)(O2)CC7=CC=CC=C7)C(=C)C | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@@H]1C[C@]2([C@H]3[C@H]4[C@]1([C@@H]5C=C(C(=O)[C@]5(CC(=C4)COC(=O)CC6=CC(=C(C(=C6)I)O)OC)O)C)O[C@](O3)(O2)CC7=CC=CC=C7)C(=C)C | ??? |
| P129 | physically interacts with | ... | Q413209 (Transient receptor potential cation channel subfamily V member 1) | Transient receptor potential cation channel subfamily V member 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 535974-91-5 |
| P592 | ChEMBL ID | CHEMBL595069 |
| P661 | ChemSpider ID | 21245027 |
| P8494 | DSSTOX compound identifier | DTXCID50535958 |
| P3117 | DSSTox substance ID | DTXSID30585193 |
| P646 | Freebase ID | /m/0805wd8 |
| P595 | Guide to Pharmacology Ligand ID | 4109 |
| P234 | InChI | InChI=1S/C37H39IO9/c1-20(2)35-16-22(4)37-26(33(35)45-36(46-35,47-37)18-23-9-7-6-8-10-23)12-25(17-34(42)29(37)11-21(3)32(34)41)19-44-30(39)15-24-13-27(38)31(40)28(14-24)43-5/h6-14,22,26,29,33,40,42H,1,15-19H2,2-5H3/t22-,26+,29-,33-,34-,35-,36-,37-/m1/s1 |
| P235 | InChIKey | TZUJORCXGLGWDV-DZBJMWFRSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2776185646 |
| P2085 | Nikkaji ID | J2.183.766K |
| P11199 | Probes And Drugs ID | PD018693 |
| P662 | PubChem CID | 6324614 |
| P2877 | SureChEMBL ID | 21168949 |
| P11089 | UniChem compound ID | 49978 |
Why not click here or view trends?
log id: 6123077