Wikidata entity: Q347337
C₁₇H₁₅N₃O₆ (P274)
Quantities
| P4250 | defined daily dose | 6.75 |
| P2067 | mass | 357.0961 |
| P3780 | active ingredient in | ... | Q47521386 (Colazal) | Colazal |
| P3780 | active ingredient in | ... | Q47521649 (Giazo) | Giazo |
| P233 | canonical SMILES | String | C1=CC(=CC=C1C(=O)NCCC(=O)O)N=NC2=CC=C(C(=C2)C(=O)O)O | ??? |
| P373 | Commons category | String | Balsalazide | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1=CC(=CC=C1C(=O)NCCC(=O)O)/N=N/C2=CC=C(C(=C2)C(=O)O)O | ??? |
| P2175 | medical condition treated | ... | Q1477 (ulcerative colitis) | ulcerative colitis |
| P3489 | pregnancy category | ... | Q28123616 (US pregnancy category B) | US pregnancy category B |
| P279 | subclass of | ... | Q49848922 (aminosalicylic acids) | aminosalicylic acids |
| P2868 | subject has role | ... | Q188724 (non-steroidal anti-inflammatory drug) | non-steroidal anti-inflammatory drug |
| P2868 | subject has role | ... | Q16909071 (5-lipoxygenase inhibitor) | 5-lipoxygenase inhibitor |
| P2868 | subject has role | ... | Q20522059 (cyclooxygenase inhibitors) | cyclooxygenase inhibitors |
| P2868 | subject has role | ... | Q50377202 (gastrointestinal agent) | gastrointestinal agent |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | balsalazide | ??? |
| P267 | ATC code | A07EC04 |
| P231 | CAS Registry Number | 80573-04-2 |
| P683 | ChEBI ID | 267413 |
| P592 | ChEMBL ID | CHEMBL1201346 |
| P661 | ChemSpider ID | 10662422 |
| P557 | DiseasesDB | 30849 |
| P715 | DrugBank ID | DB01014 |
| P8494 | DSSTOX compound identifier | DTXCID5020653 |
| P3117 | DSSTox substance ID | DTXSID7040653 |
| P232 | EC number | 617-116-8 |
| P2566 | ECHA Substance Infocard ID | 100.117.186 |
| P646 | Freebase ID | /m/0d4hxw |
| P2057 | Human Metabolome Database ID | HMDB0015149 |
| P234 | InChI | InChI=1S/C17H15N3O6/c21-14-6-5-12(9-13(14)17(25)26)20-19-11-3-1-10(2-4-11)16(24)18-8-7-15(22)23/h1-6,9,21H,7-8H2,(H,18,24)(H,22,23)(H,25,26)/b20-19+ |
| P235 | InChIKey | IPOKCKJONYRRHP-FMQUCBEESA-N |
| P665 | KEGG ID | D07488 |
| P10245 | MedlinePlus drug identifier | a699052 |
| P486 | MeSH descriptor ID | C038637 |
| P6366 | Microsoft Academic ID (discontinued) | 2780567648 |
| P2115 | NDF-RT ID | N0000148675 |
| P11199 | Probes And Drugs ID | PD009593 |
| P662 | PubChem CID | 5362070 |
| P1579 | Reaxys registry number | 8081576 |
| P3345 | RxNorm CUI | 18747 |
| P2877 | SureChEMBL ID | 118300 |
| P2892 | UMLS CUI | C0052940 |
| P652 | UNII | P80AL8J7ZP |
| P11143 | WikiProjectMed ID | Balsalazide |
Why not click here or view trends?
log id: 2777375