Wikidata entity: Q347621
C₁₄H₁₀N₂O₆ (P274)
Quantities
| P4250 | defined daily dose | 1 |
| P2067 | mass | 302.05388603999995 |
| P3780 | active ingredient in | ... | Q47521491 (Dipentum) | Dipentum |
| P233 | canonical SMILES | String | OC(=O)c1cc(ccc1O)N=Nc2ccc(O)c(c2)C(=O)O | ??? |
| P373 | Commons category | String | Olsalazine | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | O=C(O)c1cc(/N=N/c2ccc(O)c(C(=O)O)c2)ccc1O | ??? |
| P2175 | medical condition treated | ... | Q1477 (ulcerative colitis) | ulcerative colitis |
| P1748 | NCI Thesaurus ID | String | C1176 | ??? |
| P769 | significant drug interaction | ... | Q18939 (azathioprine) | azathioprine |
| P769 | significant drug interaction | ... | Q27114691 (mercaptopurine hydrate) | mercaptopurine hydrate |
| P279 | subclass of | ... | Q49848922 (aminosalicylic acids) | aminosalicylic acids |
| P2868 | subject has role | ... | Q188724 (non-steroidal anti-inflammatory drug) | non-steroidal anti-inflammatory drug |
| P2868 | subject has role | ... | Q16909071 (5-lipoxygenase inhibitor) | 5-lipoxygenase inhibitor |
| P2868 | subject has role | ... | Q20522059 (cyclooxygenase inhibitors) | cyclooxygenase inhibitors |
| P2868 | subject has role | ... | Q50377202 (gastrointestinal agent) | gastrointestinal agent |
| P267 | ATC code | A07EC03 |
| P231 | CAS Registry Number | 15722-48-2 |
| P683 | ChEBI ID | 7770 |
| P592 | ChEMBL ID | CHEMBL425 |
| P661 | ChemSpider ID | 10642377 |
| P715 | DrugBank ID | DB01250 |
| P8494 | DSSTOX compound identifier | DTXCID003391 |
| P3117 | DSSTox substance ID | DTXSID8023391 |
| P232 | EC number | 605-089-5 |
| P2566 | ECHA Substance Infocard ID | 100.116.494 |
| P646 | Freebase ID | /m/0d4j3f |
| P2057 | Human Metabolome Database ID | HMDB0015380 |
| P234 | InChI | InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ |
| P235 | InChIKey | QQBDLJCYGRGAKP-FOCLMDBBSA-N |
| P665 | KEGG ID | C07323 |
| P10245 | MedlinePlus drug identifier | a601088 |
| P486 | MeSH descriptor ID | C032587 |
| P6366 | Microsoft Academic ID (discontinued) | 2780854051 |
| P2115 | NDF-RT ID | N0000147949 |
| P11199 | Probes And Drugs ID | PD009937 |
| P662 | PubChem CID | 6003770 |
| P3345 | RxNorm CUI | 32385 |
| P2877 | SureChEMBL ID | 25118 |
| P652 | UNII | ULS5I8J03O |
| P11143 | WikiProjectMed ID | Olsalazine |
Why not click here or view trends?
log id: 2853356