Wikidata entity: Q3733837
C₉H₁₂N₄O₃ (P274)
Quantities
| P2067 | mass | 224.091 |
| P233 | canonical SMILES | String | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCO | ??? |
| P1889 | different from | ... | Q407308 (theophylline) | theophylline |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q35869 (asthma) | asthma |
| P2175 | medical condition treated | ... | Q199804 (chronic obstructive pulmonary disease) | chronic obstructive pulmonary disease |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q927234 (bronchodilator) | bronchodilator |
| P231 | CAS Registry Number | 519-37-9 |
| P683 | ChEBI ID | 94764 |
| P592 | ChEMBL ID | CHEMBL699 |
| P661 | ChemSpider ID | 1820 |
| P11198 | DrugCentral ID | 1107 |
| P8494 | DSSTOX compound identifier | DTXCID603031 |
| P3117 | DSSTox substance ID | DTXSID5023031 |
| P232 | EC number | 208-269-8 |
| P2566 | ECHA Substance Infocard ID | 100.007.519 |
| P2671 | Google Knowledge Graph ID | /g/1hc0hqmnh |
| P2057 | Human Metabolome Database ID | HMDB0252111 |
| P234 | InChI | InChI=1S/C9H12N4O3/c1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h5,14H,3-4H2,1-2H3 |
| P235 | InChIKey | NWPRCRWQMGIBOT-UHFFFAOYSA-N |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP011931 |
| P486 | MeSH descriptor ID | C008749 |
| P2840 | NSC number | 113373 |
| P11199 | Probes And Drugs ID | PD000042 |
| P662 | PubChem CID | 1892 |
| P3345 | RxNorm CUI | 24611 |
| P4964 | SPLASH | splash10-0059-9000000000-52db58ceb5fd1e7148af |
| P2877 | SureChEMBL ID | 149271 |
| P11089 | UniChem compound ID | 610557 |
| P652 | UNII | L164909TBI |
Why not click here or view trends?
log id: 3383775