| P50 | author | Bin Li | Q42430118 |
| | Banglin Chen | Q42430129 |
| P2093 | author name string | Hailong Wang | |
| P2860 | cites work | Microporous metal–organic frameworks for acetylene storage and separation | Q58509175 |
| | Selective gas adsorption within a five-connected porous metal–organic framework | Q58509234 |
| | Effect of zeolitic imidazolate frameworks on the gas transport performance of ZIF8-poly(1,4-phenylene ether-ether-sulfone) hybrid membranes | Q58877360 |
| | A microporous metal–organic framework assembled from an aromatic tetracarboxylate for H2 purification | Q59281579 |
| | A Microporous Metal-Organic Framework for Highly Selective Separation of Acetylene, Ethylene, and Ethane from Methane at Room Temperature | Q59281584 |
| | A microporous lanthanide-tricarboxylate framework with the potential for purification of natural gas | Q59281587 |
| | A robust doubly interpenetrated metal–organic framework constructed from a novel aromatic tricarboxylate for highly selective separation of small hydrocarbons | Q59281588 |
| | Cu-TDPAT, an rht-Type Dual-Functional Metal–Organic Framework Offering Significant Potential for Use in H2 and Natural Gas Purification Processes Operating at High Pressures | Q59281592 |
| | High Separation Capacity and Selectivity of C2 Hydrocarbons over Methane within a Microporous Metal-Organic Framework at Room Temperature | Q59281593 |
| | Interplay of Metalloligand and Organic Ligand to Tune Micropores within Isostructural Mixed-Metal Organic Frameworks (M′MOFs) for Their Highly Selective Separation of Chiral and Achiral Small Molecules | Q59281595 |
| | Metal–organic frameworks with potential for energy-efficient adsorptive separation of light hydrocarbons | Q59281598 |
| | Microporous metal–organic frameworks for storage and separation of small hydrocarbons | Q59281599 |
| | Enhanced carbon dioxide capture upon incorporation of N,N′-dimethylethylenediamine in the metal–organic framework CuBTTri | Q59281609 |
| | The Mechanism of Carbon Dioxide Adsorption in an Alkylamine-Functionalized Metal–Organic Framework | Q59286698 |
| | Ultrahigh porosity in metal-organic frameworks | Q28286732 |
| | Metal-organic frameworks as a tunable platform for designing functional molecular materials | Q28662327 |
| | Metal−Organic Frameworks as Adsorbents for Hydrogen Purification and Precombustion Carbon Dioxide Capture | Q29039279 |
| | A rationale for the large breathing of the porous aluminum terephthalate (MIL-53) upon hydration | Q30914469 |
| | Synthesis, structure, and carbon dioxide capture properties of zeolitic imidazolate frameworks | Q33514029 |
| | Novel pyrrolopyrimidine-based α-helix mimetics: cell-permeable inhibitors of protein−protein interactions | Q33775959 |
| | Metal-organic frameworks with exceptionally high capacity for storage of carbon dioxide at room temperature | Q33992386 |
| | Secondary building units, nets and bonding in the chemistry of metal-organic frameworks | Q34017165 |
| | Reticular synthesis and the design of new materials | Q34205294 |
| | A chromium terephthalate-based solid with unusually large pore volumes and surface area. | Q34453213 |
| | Porous materials with optimal adsorption thermodynamics and kinetics for CO2 separation | Q34601680 |
| | Highly efficient separation of carbon dioxide by a metal-organic framework replete with open metal sites | Q35015218 |
| | Functional porous coordination polymers | Q35758845 |
| | Adsorption properties of HKUST-1 toward hydrogen and other small molecules monitored by IR. | Q36879077 |
| | Metal-organic frameworks with high capacity and selectivity for harmful gases | Q36954534 |
| | Polymerization reactions in porous coordination polymers | Q37454404 |
| | Large breathing effects in three-dimensional porous hybrid matter: facts, analyses, rules and consequences | Q37454435 |
| | Design and synthesis of metal-organic frameworks using metal-organic polyhedra as supermolecular building blocks. | Q37454441 |
| | Selective gas adsorption and separation in metal-organic frameworks. | Q37454466 |
| | Carbon dioxide capture: prospects for new materials | Q37774972 |
| | Engineering Homochiral Metal‐Organic Frameworks for Heterogeneous Asymmetric Catalysis and Enantioselective Separation | Q37783590 |
| | Luminescent functional metal-organic frameworks | Q37891946 |
| | Postsynthetic methods for the functionalization of metal-organic frameworks | Q37931860 |
| | Metal azolate frameworks: from crystal engineering to functional materials | Q37937027 |
| | Metal-organic frameworks for separations | Q37942996 |
| | Mesoporous metal-organic framework materials | Q37947065 |
| | Progress in adsorption-based CO2 capture by metal-organic frameworks | Q37964925 |
| | Hydrogen storage in metal-organic frameworks. | Q37970716 |
| | Carbon dioxide capture in metal-organic frameworks | Q37972005 |
| | Commensurate adsorption of hydrocarbons and alcohols in microporous metal organic frameworks | Q37976871 |
| | Expanded organic building units for the construction of highly porous metal-organic frameworks | Q39335035 |
| | Development of composite inorganic building blocks for MOFs. | Q40474550 |
| | Selective binding of O2 over N2 in a redox-active metal-organic framework with open iron(II) coordination sites | Q42612518 |
| | Screening of metal-organic frameworks for carbon dioxide capture from flue gas using a combined experimental and modeling approach | Q42641481 |
| | Hydrocarbon separations in a metal-organic framework with open iron(II) coordination sites | Q42642132 |
| | Surface interactions and quantum kinetic molecular sieving for H2 and D2 adsorption on a mixed metal-organic framework material | Q42653194 |
| | Chemically blockable transformation and ultraselective low-pressure gas adsorption in a non-porous metal organic framework | Q42742729 |
| | Flexibility and sorption selectivity in rigid metal-organic frameworks: the impact of ether-functionalised linkers. | Q42782926 |
| | Ethane/ethene separation turned on its head: selective ethane adsorption on the metal-organic framework ZIF-7 through a gate-opening mechanism | Q42790875 |
| | Steam-Stable Zeolitic Imidazolate Framework ZIF-90 Membrane with Hydrogen Selectivity through Covalent Functionalization | Q42852991 |
| | Selective sorption of oxygen and nitric oxide by an electron-donating flexible porous coordination polymer | Q42961748 |
| | Molecular-sieve membrane with hydrogen permselectivity: ZIF-22 in LTA topology prepared with 3-aminopropyltriethoxysilane as covalent linker | Q43029999 |
| | A pulse chromatographic study of the adsorption properties of the amino-MIL-53 (Al) metal-organic framework. | Q43039821 |
| | Highly-selective and reversible O2 binding in Cr3(1,3,5-benzenetricarboxylate)2. | Q43060370 |
| | Metal-organic frameworks with functional pores for recognition of small molecules | Q43070183 |
| | Multiple functional groups of varying ratios in metal-organic frameworks | Q43164738 |
| | Metal-organic framework MIL-101 for high-resolution gas-chromatographic separation of xylene isomers and ethylbenzene | Q43187443 |
| | High and selective CO2 uptake in a cobalt adeninate metal-organic framework exhibiting pyrimidine- and amino-decorated pores | Q43226089 |
| | Zeolitic imidazolate framework membrane with molecular sieving properties by microwave-assisted solvothermal synthesis. | Q43258315 |
| | Zeolitic imidazolate frameworks for kinetic separation of propane and propene | Q43282575 |
| | A pillared-layer coordination polymer with a rotatable pillar acting as a molecular gate for guest molecules | Q43291881 |
| | Enhancing CO2 adsorption of a Zn-phosphonocarboxylate framework by pore space partitions | Q43671668 |
| | Fine-tuning pore size by shifting coordination sites of ligands and surface polarization of metal-organic frameworks to sharply enhance the selectivity for CO2. | Q45176821 |
| | Self-accelerating CO sorption in a soft nanoporous crystal | Q45823572 |
| | Structural transitions in MIL-53 (Cr): view from outside and inside. | Q45901640 |
| | Framework breathing in the vapour-phase adsorption and separation of xylene isomers with the metal-organic framework MIL-53. | Q45955408 |
| | Control of pore size and functionality in isoreticular zeolitic imidazolate frameworks and their carbon dioxide selective capture properties. | Q45968781 |
| | Strong CO2 binding in a water-stable, triazolate-bridged metal-organic framework functionalized with ethylenediamine. | Q45978504 |
| | Preparation and gas adsorption studies of three mesh-adjustable molecular sieves with a common structure. | Q46044523 |
| | Separation of hexane isomers in a metal-organic framework with triangular channels | Q46138343 |
| | Molecular simulations for adsorption and separation of natural gas in IRMOF-1 and Cu-BTC metal-organic frameworks. | Q46224894 |
| | Generalized synthesis of zeolite-type metal-organic frameworks encapsulating immobilized transition-metal clusters | Q46335420 |
| | Effect of open metal sites on adsorption of polar and nonpolar molecules in metal-organic framework Cu-BTC. | Q46481132 |
| | Pore-filling-dependent selectivity effects in the vapor-phase separation of xylene isomers on the metal-organic framework MIL-47. | Q46602173 |
| | Quantum sieving effect of three-dimensional Cu-based organic framework for H2 and D2. | Q46620814 |
| | Multifunctional fourfold interpenetrating diamondoid network: gas separation and fabrication of palladium nanoparticles | Q46695632 |
| | Comparative molecular simulation study of CO2/N2 and CH4/N2 separation in zeolites and metal-organic frameworks | Q46746991 |
| | Low-energy regeneration and high productivity in a lanthanide-hexacarboxylate framework for high-pressure CO2-CH4-H2 separation | Q46767302 |
| | Capture of carbon dioxide from air and flue gas in the alkylamine-appended metal-organic framework mmen-Mg2(dobpdc). | Q46776124 |
| | Carborane-based metal-organic frameworks as highly selective sorbents for CO(2) over methane | Q47339896 |
| | Dramatic tuning of carbon dioxide uptake via metal substitution in a coordination polymer with cylindrical pores | Q47427369 |
| | Different adsorption behaviors of methane and carbon dioxide in the isotypic nanoporous metal terephthalates MIL-53 and MIL-47. | Q47720281 |
| | Kinetic gate-opening process in a flexible porous coordination polymer | Q47778681 |
| | Evidence of CO(2) molecule acting as an electron acceptor on a nanoporous metal-organic-framework MIL-53 or Cr(3+)(OH)(O(2)C-C(6)H(4)-CO(2)). | Q50684930 |
| | Electrostatically mediated specific adsorption of small molecules in metallo-organic frameworks. | Q51097486 |
| | Two stable 3D metal-organic frameworks constructed by nanoscale cages via sharing the single-layer walls. | Q51294620 |
| | Guest-induced asymmetry in a metal-organic porous solid with reversible single-crystal-to-single-crystal structural transformation. | Q51308892 |
| | Selectivity and direct visualization of carbon dioxide and sulfur dioxide in a decorated porous host. | Q53356386 |
| | Polymer-supported and free-standing metal-organic framework membrane. | Q53863972 |
| | Topological Analysis of Metal–Organic Frameworks with Polytopic Linkers and/or Multiple Building Units and the Minimal Transitivity Principle | Q56086554 |
| | Deconstructing the Crystal Structures of Metal–Organic Frameworks and Related Materials into Their Underlying Nets | Q56086597 |
| | MOF-74 building unit has a direct impact on toxic gas adsorption | Q56086611 |
| | A Microporous Metal–Organic Framework for Gas-Chromatographic Separation of Alkanes | Q56086690 |
| | Rod Packings and Metal−Organic Frameworks Constructed from Rod-Shaped Secondary Building Units | Q56086778 |
| | A Chemically Functionalizable Nanoporous Material [Cu3(TMA)2(H2O)3]n | Q56523467 |
| | Carbon dioxide capture-related gas adsorption and separation in metal-organic frameworks | Q56609440 |
| | Mixed-Matrix Membrane Hollow Fibers of Cu3(BTC)2MOF and Polyimide for Gas Separation and Adsorption | Q56934570 |
| | An Amine-Functionalized MIL-53 Metal−Organic Framework with Large Separation Power for CO2and CH4 | Q57388022 |
| | A solid solution approach to 2D coordination polymers for CH4/CO2and CH4/C2H6gas separation: equilibrium and kinetic studies | Q57718367 |
| | Porous metal–organic frameworks as platforms for functional applications | Q57720644 |
| | Nonclassical Active Site for Enhanced Gas Sorption in Porous Coordination Polymer | Q57732646 |
| | Highly Selective Carbon Dioxide Uptake by [Cu(bpy-n)2(SiF6)] (bpy-1 = 4,4′-Bipyridine; bpy-2 = 1,2-Bis(4-pyridyl)ethene) | Q57834029 |
| | Enhanced CO2Binding Affinity of a High-Uptakerht-Type Metal−Organic Framework Decorated with Acylamide Groups | Q57834058 |
| | A New Approach to Construct a Doubly Interpenetrated Microporous Metal-Organic Framework of Primitive Cubic Net for Highly Selective Sorption of Small Hydrocarbon Molecules | Q58509099 |
| | Microporous metal-organic framework with potential for carbon dioxide capture at ambient conditions | Q58509132 |
| P433 | issue | 6 | |
| P921 | main subject | Metal-organic framework | Q909212 |
| P304 | page(s) | 1474-1498 | |
| P577 | publication date | 2014-03-25 | |
| P1433 | published in | Chemistry - An Asian Journal | Q2962570 |
| P1476 | title | Microporous metal-organic frameworks for gas separation | |
| P478 | volume | 9 | |