| P233 |
canonical SMILES |
String |
C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N |
??? |
| P972 |
catalog |
... |
Q90481889 (CAS COVID-19 Anti-Viral Candidate Compounds) |
CAS COVID-19 Anti-Viral Candidate Compounds |
| P373 |
Commons category |
String |
Guanosine triphosphate |
??? |
| P703 |
found in taxon |
... |
Q30092 (Lumbricus terrestris) |
Lumbricus terrestris |
| P703 |
found in taxon |
... |
Q91703 (Caenorhabditis elegans) |
Caenorhabditis elegans |
| P703 |
found in taxon |
... |
Q15978631 (Homo sapiens) |
Homo sapiens |
| P703 |
found in taxon |
... |
Q146190 (Helianthus tuberosus) |
Helianthus tuberosus |
| P703 |
found in taxon |
... |
Q25419 (Escherichia coli) |
Escherichia coli |
| P527 |
has part(s) |
... |
Q627 (nitrogen) |
nitrogen |
| P527 |
has part(s) |
... |
Q629 (oxygen) |
oxygen |
| P527 |
has part(s) |
... |
Q623 (carbon) |
carbon |
| P31 |
instance of |
... |
Q59199015 (group of stereoisomers) |
group of stereoisomers |
| P2017 |
isomeric SMILES |
String |
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N |
??? |
| P361 |
part of |
... |
Q14863341 (GTP binding) |
GTP binding |
| P361 |
part of |
... |
Q14916509 (GTP biosynthetic process) |
GTP biosynthetic process |
| P361 |
part of |
... |
Q21103433 (GTP metabolic process) |
GTP metabolic process |
| P361 |
part of |
... |
Q21108048 (molybdopterin cofactor biosynthetic process) |
molybdopterin cofactor biosynthetic process |
| P361 |
part of |
... |
Q22324675 (GTP:GDP antiporter activity) |
GTP:GDP antiporter activity |
| P129 |
physically interacts with |
... |
Q21126779 (Pyrimidinergic receptor P2Y4) |
Pyrimidinergic receptor P2Y4 |
| P129 |
physically interacts with |
... |
Q21497890 (Potassium inwardly-rectifying channel, subfamily J, member 8) |
Potassium inwardly-rectifying channel, subfamily J, member 8 |
| P279 |
subclass of |
... |
Q72148863 (purine ribonucleoside 5'-triphosphate) |
purine ribonucleoside 5'-triphosphate |
| P2868 |
subject has role |
... |
Q3333419 (primary metabolite) |
primary metabolite |
| P7033 | Australian Educational Vocabulary ID | scot/12788 |
| P268 | Bibliothèque nationale de France ID | 12412732c |
| P508 | BNCF Thesaurus ID | 38323 |
| P8072 | CAB ID | 172621 |
| P11160 | Cannabis Database ID | 005097 |
| P231 | CAS Registry Number | 86-01-1 |
| P683 | ChEBI ID | 15996 |
| P592 | ChEMBL ID | CHEMBL1233147 |
| P661 | ChemSpider ID | 6569 |
| P715 | DrugBank ID | DB04137 |
| P8494 | DSSTOX compound identifier | DTXCID30157819 |
| P3117 | DSSTox substance ID | DTXSID30235328 |
| P232 | EC number | 201-647-3 |
| P2566 | ECHA Substance Infocard ID | 100.001.498 |
| P1417 | Encyclopædia Britannica Online ID | science/guanosine-triphosphate |
| P646 | Freebase ID | /m/0239sv |
| P12385 | Gran Enciclopèdia Catalana ID | trifosfat-de-guanosina |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0031254 |
| P595 | Guide to Pharmacology Ligand ID | 1742 |
| P2057 | Human Metabolome Database ID | HMDB0001273 |
| P234 | InChI | InChI=1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| P235 | InChIKey | XKMLYUALXHKNFT-UUOKFMHZSA-N |
| P8408 | KBpedia ID | GuanosineTriphosphate |
| P665 | KEGG ID | C00044 |
| P2064 | KNApSAcK ID | C00007223 |
| P244 | Library of Congress authority ID | sh93000026 |
| P486 | MeSH descriptor ID | D006160 |
| P672 | MeSH tree code | D03.633.100.759.646.454.504 |
| P672 | MeSH tree code | D13.695.667.454.504 |
| P672 | MeSH tree code | D13.695.827.426.504 |
| P6366 | Microsoft Academic ID (discontinued) | 2776638253 |
| P2004 | NALT ID | 44045 |
| P8189 | National Library of Israel J9U ID | 987007544092905171 |
| P10283 | OpenAlex ID | C2776638253 |
| P3636 | PDB ligand ID | GTP |
| P11199 | Probes And Drugs ID | PD046841 |
| P662 | PubChem CID | 6830 |
| P662 | PubChem CID | 135398633 |
| P1579 | Reaxys registry number | 74004 |
| P1579 | Reaxys registry number | 1201437 |
| P4964 | SPLASH | splash10-0006-0900000000-895098906ea44c18ea43 |
| P4964 | SPLASH | splash10-0002-0000920000-eea0cfe4824f5aee7e4a |
| P4964 | SPLASH | splash10-006t-0000970000-ed775d45b7d4c3b969df |
| P4964 | SPLASH | splash10-00di-0000090000-1f82803712abcc828ec1 |
| P4964 | SPLASH | splash10-00di-0000090000-669ebc7a9cdc5eb7af94 |
| P4964 | SPLASH | splash10-00di-0000090000-a102394a5714eb4b4767 |
| P4964 | SPLASH | splash10-0fk9-0600090000-ec39ebfa9c8f53397196 |
| P4964 | SPLASH | splash10-0udi-0900000000-5c5ec4194fcf5d649bf3 |
| P4964 | SPLASH | splash10-0udi-0900000000-b64c8b188c97e20420a1 |
| P4964 | SPLASH | splash10-0udi-1900000000-137b3f5a2e96491bc405 |
| P4964 | SPLASH | splash10-0udi-1900000000-4cded7065705e54df409 |
| P4964 | SPLASH | splash10-0udi-1900000000-df040a761d3972e66b82 |
| P2877 | SureChEMBL ID | 44408 |
| P2877 | SureChEMBL ID | 44409 |
| P2892 | UMLS CUI | C0018353 |
| P652 | UNII | 01WV7J708X |
| P3471 | WikiSkripta article ID | 58427 |
| P13591 | Yale LUX ID | concept/8382ef11-c4ed-4070-9509-27f7de64c94b |