Wikidata entity: Q395229
C₁₅H₁₇NO₂ (P274)
Quantities
| P4250 | defined daily dose | 25 |
| P2067 | mass | 243.125929 |
| P3780 | active ingredient in | ... | Q29006567 (Thymanax) | Thymanax |
| P3780 | active ingredient in | ... | Q29006623 (Valdoxan) | Valdoxan |
| P233 | canonical SMILES | String | CC(=O)NCCC1=CC=CC2=C1C=C(C=C2)OC | ??? |
| P373 | Commons category | String | Agomelatine | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q42844 (major depressive disorder) | major depressive disorder |
| P129 | physically interacts with | ... | Q1949517 (5-hydroxytryptamine receptor 2A) | 5-hydroxytryptamine receptor 2A |
| P129 | physically interacts with | ... | Q4639596 (5-hydroxytryptamine receptor 2B) | 5-hydroxytryptamine receptor 2B |
| P129 | physically interacts with | ... | Q21108118 (5-hydroxytryptamine receptor 2C) | 5-hydroxytryptamine receptor 2C |
| P129 | physically interacts with | ... | Q21122995 (Melatonin receptor 1A) | Melatonin receptor 1A |
| P129 | physically interacts with | ... | Q21122997 (Melatonin receptor 1B) | Melatonin receptor 1B |
| P3489 | pregnancy category | ... | Q3679232 (Australian pregnancy category B1) | Australian pregnancy category B1 |
| P279 | subclass of | ... | Q130307099 (methoxybenzene) | methoxybenzene |
| P279 | subclass of | ... | Q72591894 (acetamides) | acetamides |
| P2868 | subject has role | ... | Q50377192 (hypnotics and sedatives) | hypnotics and sedatives |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | agomelatine | ??? |
| P267 | ATC code | N06AX22 |
| P231 | CAS Registry Number | 138112-76-2 |
| P683 | ChEBI ID | 134990 |
| P592 | ChEMBL ID | CHEMBL10878 |
| P661 | ChemSpider ID | 74141 |
| P715 | DrugBank ID | DB06594 |
| P11198 | DrugCentral ID | 99 |
| P8494 | DSSTOX compound identifier | DTXCID4031431 |
| P3117 | DSSTox substance ID | DTXSID3057642 |
| P232 | EC number | 629-727-7 |
| P2566 | ECHA Substance Infocard ID | 100.157.896 |
| P646 | Freebase ID | /m/09d7nm |
| P595 | Guide to Pharmacology Ligand ID | 198 |
| P2057 | Human Metabolome Database ID | HMDB0015636 |
| P234 | InChI | InChI=1S/C15H17NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-7,10H,8-9H2,1-2H3,(H,16,17) |
| P235 | InChIKey | YJYPHIXNFHFHND-UHFFFAOYSA-N |
| P665 | KEGG ID | D02578 |
| P486 | MeSH descriptor ID | C084711 |
| P6366 | Microsoft Academic ID (discontinued) | 2780798758 |
| P691 | NL CR AUT ID | ph769114 |
| P10283 | OpenAlex ID | C2780798758 |
| P3636 | PDB ligand ID | AWY |
| P11199 | Probes And Drugs ID | PD009296 |
| P662 | PubChem CID | 82148 |
| P4964 | SPLASH | splash10-000i-1910000000-17cebfbe6b9845617b5d |
| P2877 | SureChEMBL ID | 114476 |
| P4527 | UK Parliament thesaurus ID | 460554 |
| P11089 | UniChem compound ID | 510887 |
| P652 | UNII | 137R1N49AD |
| P11143 | WikiProjectMed ID | Agomelatine |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 7392 |
Why not click here or view trends?
log id: 3283644