Wikidata entity: Q4042503
C₁₉H₁₇NO₃ (P274)
Quantities
| P2067 | mass | 307.121 |
| P233 | canonical SMILES | String | C1COCCN1C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=CC=C4 | ??? |
| P703 | found in taxon | ... | Q2716887 (Dietes bicolor) | Dietes bicolor |
| P703 | found in taxon | ... | Q10523775 (Hexagonia apiaria) | Hexagonia apiaria |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q7117823 (Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit alpha) | Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit alpha |
| P129 | physically interacts with | ... | Q7117825 (Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit delta) | Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit delta |
| P129 | physically interacts with | ... | Q21100441 (Bromodomain containing 4) | Bromodomain containing 4 |
| P129 | physically interacts with | ... | Q21100450 (Bromodomain containing 2) | Bromodomain containing 2 |
| P129 | physically interacts with | ... | Q21100464 (bromodomain containing 3) | bromodomain containing 3 |
| P129 | physically interacts with | ... | Q21115992 (Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta) | Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta |
| P129 | physically interacts with | ... | Q21123236 (Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma) | Phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q427492 (enzyme inhibitor) | enzyme inhibitor |
| P231 | CAS Registry Number | 154447-36-6 |
| P683 | ChEBI ID | 65329 |
| P592 | ChEMBL ID | CHEMBL98350 |
| P661 | ChemSpider ID | 3835 |
| P715 | DrugBank ID | DB02656 |
| P8494 | DSSTOX compound identifier | DTXCID4022650 |
| P3117 | DSSTox substance ID | DTXSID6042650 |
| P646 | Freebase ID | /m/03yfg60 |
| P595 | Guide to Pharmacology Ligand ID | 6004 |
| P2057 | Human Metabolome Database ID | HMDB0244699 |
| P234 | InChI | InChI=1S/C19H17NO3/c21-17-13-18(20-9-11-22-12-10-20)23-19-15(7-4-8-16(17)19)14-5-2-1-3-6-14/h1-8,13H,9-12H2 |
| P235 | InChIKey | CZQHHVNHHHRRDU-UHFFFAOYSA-N |
| P665 | KEGG ID | C15195 |
| P486 | MeSH descriptor ID | C085911 |
| P6366 | Microsoft Academic ID (discontinued) | 2776912716 |
| P2840 | NSC number | 697286 |
| P10283 | OpenAlex ID | C2776912716 |
| P3636 | PDB ligand ID | LY2 |
| P638 | PDB structure ID | 1YI3 |
| P638 | PDB structure ID | 4AZT |
| P638 | PDB structure ID | 1E7V |
| P638 | PDB structure ID | 4CFK |
| P11199 | Probes And Drugs ID | PD007784 |
| P662 | PubChem CID | 3973 |
| P1579 | Reaxys registry number | 8156139 |
| P2877 | SureChEMBL ID | 94377 |
| P11089 | UniChem compound ID | 298523 |
| P652 | UNII | 31M2U1DVID |
Why not click here or view trends?
log id: 2127770