Wikidata entity: Q408038
C₂H₃ClO (P274)
Quantities
| P2102 | boiling point | 50.75 |
| P2201 | electric dipole moment | 2.72 |
| P2260 | ionization energy | 10.85 |
| P2067 | mass | 77.987 |
| P2101 | melting point | -112.85 |
| P2101 | melting point | -112 |
| P233 | canonical SMILES | String | CC(=O)Cl | ??? |
| P373 | Commons category | String | Acetyl chloride | ??? |
| P1889 | different from | ... | Q409013 (chloroacetic acid) | chloroacetic acid |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q688 (chlorine) | chlorine |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P279 | subclass of | ... | Q1035584 (acyl chloride) | acyl chloride |
| P11931 | CAMEO Chemicals ID | 2284 |
| P231 | CAS Registry Number | 75-36-5 |
| P683 | ChEBI ID | 37580 |
| P661 | ChemSpider ID | 6127 |
| P715 | DrugBank ID | DB14623 |
| P8494 | DSSTOX compound identifier | DTXCID203852 |
| P3117 | DSSTox substance ID | DTXSID2023852 |
| P232 | EC number | 200-865-6 |
| P2566 | ECHA Substance Infocard ID | 100.000.787 |
| P10565 | Encyclopedia of China (Third Edition) ID | 157367 |
| P646 | Freebase ID | /m/05bm2c |
| P1578 | Gmelin number | 1611 |
| P227 | GND ID | 4326984-9 |
| P4342 | Great Norwegian Encyclopedia ID | acetylklorid |
| P7025 | HCIS ID | 69 |
| P2062 | HSDB ID | 662 |
| P2057 | Human Metabolome Database ID | HMDB0247922 |
| P5220 | ICSC ID | 0210 |
| P234 | InChI | InChI=1S/C2H3ClO/c1-2(3)4/h1H3 |
| P235 | InChIKey | WETWJCDKMRHUPV-UHFFFAOYSA-N |
| P8408 | KBpedia ID | AcetylChloride |
| P8313 | Lex ID | acetylklorid |
| P6366 | Microsoft Academic ID (discontinued) | 2780978688 |
| P9405 | NMRShiftDB structure ID | 10008827 |
| P10283 | OpenAlex ID | C2780978688 |
| P11199 | Probes And Drugs ID | PD094466 |
| P662 | PubChem CID | 6367 |
| P1579 | Reaxys registry number | 605303 |
| P657 | RTECS number | AO6390000 |
| P4964 | SPLASH | splash10-0006-9000000000-c8a608610f23881638a3 |
| P2877 | SureChEMBL ID | 519 |
| P2877 | SureChEMBL ID | 11026359 |
| P2877 | SureChEMBL ID | 5180151 |
| P11089 | UniChem compound ID | 1105532 |
| P652 | UNII | QD15RNO45K |
| P679 | ZVG number | 31420 |
Why not click here or view trends?
log id: 2668109