Wikidata entity: Q408652
C₈H₁₄ClN₅ (P274)
Quantities
| P2054 | density | 1.19 |
| P2067 | mass | 215.094 |
| P2240 | median lethal dose (LD50) | 1 |
| P2240 | median lethal dose (LD50) | 2 |
| P2240 | median lethal dose (LD50) | 3 |
| P2240 | median lethal dose (LD50) | 235 |
| P2240 | median lethal dose (LD50) | 626 |
| P2240 | median lethal dose (LD50) | 672 |
| P2240 | median lethal dose (LD50) | 700 |
| P2240 | median lethal dose (LD50) | 750 |
| P2240 | median lethal dose (LD50) | 850 |
| P2240 | median lethal dose (LD50) | 5200 |
| P2240 | median lethal dose (LD50) | 7500 |
| P2101 | melting point | 340 |
| P2407 | short-term exposure limit | 2 |
| P2407 | short-term exposure limit | 20 |
| P2177 | solubility | 0.003 |
| P2404 | time-weighted average exposure limit | 2 |
| P2404 | time-weighted average exposure limit | 5 |
| P2404 | time-weighted average exposure limit | 10 |
| P2119 | vapor pressure | 0.0000003 |
| P3335 | associated hazard | ... | Q21167894 (atrazine exposure) | atrazine exposure |
| P233 | canonical SMILES | String | CCNC1=NC(=NC(=N1)Cl)NC(C)C | ??? |
| P373 | Commons category | String | Atrazine | ??? |
| P1542 | has effect | ... | Q21167894 (atrazine exposure) | atrazine exposure |
| P366 | has use | ... | Q178266 (herbicide) | herbicide |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Atrazine-3D-balls.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC/N=C/1\N/C(=N/C(C)C)/NC(=N1)Cl | ??? |
| P1987 | MCN code | String | 2933.69.13 | ??? |
| P361 | part of | ... | Q22275874 (atrazine catabolic process) | atrazine catabolic process |
| P361 | part of | ... | Q22275875 (atrazine catabolic process to urea) | atrazine catabolic process to urea |
| P361 | part of | ... | Q22276069 (atrazine catabolic process to isopropylamine) | atrazine catabolic process to isopropylamine |
| P361 | part of | ... | Q22276348 (atrazine metabolic process) | atrazine metabolic process |
| P361 | part of | ... | Q22276350 (atrazine catabolic process to cyanuric acid) | atrazine catabolic process to cyanuric acid |
| P361 | part of | ... | Q22320596 (atrazine chlorohydrolase activity) | atrazine chlorohydrolase activity |
| P279 | subclass of | ... | Q70702 (alkaloid) | alkaloid |
| P279 | subclass of | ... | Q193430 (heterocyclic compound) | heterocyclic compound |
| P2868 | subject has role | ... | Q55427776 (female reproductive toxicant) | female reproductive toxicant |
| P2868 | subject has role | ... | Q72941151 (developmental toxicant) | developmental toxicant |
Why not click here or view trends?
log id: 4184899