Wikidata entity: Q408840
C₁₀H₆N₄O₂ (P274)
Quantities
| P2067 | mass | 214.049075 |
| P233 | canonical SMILES | String | C1=CC=C2C(=C1)N=C3C(=N2)NC(=O)NC3=O | ??? |
| P373 | Commons category | String | Isoalloxazine | ??? |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21116164 (Adenosine A2b receptor) | Adenosine A2b receptor |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 490-59-5 |
| P683 | ChEBI ID | 37327 |
| P683 | ChEBI ID | 37325 |
| P592 | ChEMBL ID | CHEMBL68500 |
| P661 | ChemSpider ID | 4522915 |
| P8494 | DSSTOX compound identifier | DTXCID10120147 |
| P3117 | DSSTox substance ID | DTXSID50197656 |
| P232 | EC number | 207-714-3 |
| P2566 | ECHA Substance Infocard ID | 100.007.014 |
| P2671 | Google Knowledge Graph ID | /g/1218lfqq |
| P595 | Guide to Pharmacology Ligand ID | 456 |
| P2057 | Human Metabolome Database ID | HMDB0248162 |
| P234 | InChI | InChI=1S/C10H6N4O2/c15-9-7-8(13-10(16)14-9)12-6-4-2-1-3-5(6)11-7/h1-4H,(H2,12,13,14,15,16) |
| P235 | InChIKey | HAUGRYOERYOXHX-UHFFFAOYSA-N |
| P2840 | NSC number | 402746 |
| P2840 | NSC number | 203056 |
| P11199 | Probes And Drugs ID | PD015405 |
| P662 | PubChem CID | 5372720 |
| P1579 | Reaxys registry number | 85819 |
| P2877 | SureChEMBL ID | 57289 |
| P2877 | SureChEMBL ID | 499075 |
| P11089 | UniChem compound ID | 258629 |
| P652 | UNII | 880W3VF9YW |
Why not click here or view trends?
log id: 3699918