Wikidata entity: Q411251
C₂₁H₂₅N (P274)
Quantities
| P4250 | defined daily dose | 75 |
| P2067 | mass | 291.199 |
| P233 | canonical SMILES | String | CC1(C2=CC=CC=C2C(=CCCN(C)C)C3=CC=CC=C31)C | ??? |
| P373 | Commons category | String | Melitracen | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q544006 (anxiety disorder) | anxiety disorder |
| P2175 | medical condition treated | ... | Q4340209 (depression) | depression |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q908843 (tricyclic antidepressant) | tricyclic antidepressant |
| P267 | ATC code | N06AA14 |
| P231 | CAS Registry Number | 5118-29-6 |
| P683 | ChEBI ID | 135214 |
| P592 | ChEMBL ID | CHEMBL110094 |
| P661 | ChemSpider ID | 23697 |
| P715 | DrugBank ID | DB13384 |
| P11198 | DrugCentral ID | 1675 |
| P8494 | DSSTOX compound identifier | DTXCID5028249 |
| P3117 | DSSTox substance ID | DTXSID4048274 |
| P232 | EC number | 225-858-5 |
| P2566 | ECHA Substance Infocard ID | 100.023.507 |
| P646 | Freebase ID | /m/0gwsyj |
| P2057 | Human Metabolome Database ID | HMDB0254426 |
| P234 | InChI | InChI=1S/C21H25N/c1-21(2)19-13-7-5-10-17(19)16(12-9-15-22(3)4)18-11-6-8-14-20(18)21/h5-8,10-14H,9,15H2,1-4H3 |
| P235 | InChIKey | GWWLWDURRGNSRS-UHFFFAOYSA-N |
| P665 | KEGG ID | D08171 |
| P486 | MeSH descriptor ID | C005100 |
| P6366 | Microsoft Academic ID (discontinued) | 2779011963 |
| P11199 | Probes And Drugs ID | PD014108 |
| P662 | PubChem CID | 25382 |
| P3417 | Quora topic ID | Melitracen |
| P3345 | RxNorm CUI | 446248 |
| P5076 | Römpp online ID | RD-13-01148 |
| P2877 | SureChEMBL ID | 48975 |
| P11089 | UniChem compound ID | 619898 |
| P652 | UNII | Q7T0Y1109Z |
Why not click here or view trends?
log id: 2077511