Wikidata entity: Q411806
C₂₃H₂₁ClN₆O₃ (P274)
Quantities
| P4250 | defined daily dose | 1 |
| P2067 | mass | 464.136 |
| P233 | canonical SMILES | String | CN1CCN(CC1)C=C2C(=O)N3C(=N2)CN=C(C4=C3C=CC(=C4)[N+](=O)[O-])C5=CC=CC=C5Cl | ??? |
| P373 | Commons category | String | Loprazolam | ??? |
| P1343 | described by source | ... | Q316572 (Opium Law) | Opium Law |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN1CCN(CC1)/C=C\2/C(=O)N3C(=N2)CN=C(C4=C3C=CC(=C4)[N+](=O)[O-])C5=CC=CC=C5Cl | ??? |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q62903 (anxiolytic) | anxiolytic |
| P267 | ATC code | N05CD11 |
| P231 | CAS Registry Number | 61197-73-7 |
| P683 | ChEBI ID | 135754 |
| P592 | ChEMBL ID | CHEMBL2107448 |
| P661 | ChemSpider ID | 2298440 |
| P715 | DrugBank ID | DB13643 |
| P11198 | DrugCentral ID | 1602 |
| P8494 | DSSTOX compound identifier | DTXCID50910064 |
| P3117 | DSSTox substance ID | DTXSID30894873 |
| P2566 | ECHA Substance Infocard ID | 100.293.781 |
| P646 | Freebase ID | /m/0bcb1n |
| P234 | InChI | InChI=1S/C23H21ClN6O3/c1-27-8-10-28(11-9-27)14-19-23(31)29-20-7-6-15(30(32)33)12-17(20)22(25-13-21(29)26-19)16-4-2-3-5-18(16)24/h2-7,12,14H,8-11,13H2,1H3/b19-14- |
| P235 | InChIKey | UTEFBSAVJNEPTR-RGEXLXHISA-N |
| P486 | MeSH descriptor ID | C020168 |
| P6366 | Microsoft Academic ID (discontinued) | 2781148881 |
| P11199 | Probes And Drugs ID | PD072440 |
| P662 | PubChem CID | 3033860 |
| P3345 | RxNorm CUI | 38555 |
| P2877 | SureChEMBL ID | 153761 |
| P11089 | UniChem compound ID | 4565904 |
| P652 | UNII | 759N8462G8 |
Why not click here or view trends?
log id: 6219367