Wikidata entity: Q413079
C₄F₈ (P274)
Quantities
| P2102 | boiling point | -5.99 |
| P2201 | electric dipole moment | 0 |
| P2565 | global warming potential | 7310 |
| P2565 | global warming potential | 10300 |
| P2565 | global warming potential | 10592 |
| P2067 | mass | 199.987 |
| P2101 | melting point | -40.19 |
| P233 | canonical SMILES | String | C1(C(C(C1(F)F)(F)F)(F)F)(F)F | ??? |
| P373 | Commons category | String | Octafluorocyclobutane | ??? |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q650 (fluorine) | fluorine |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q4214615 (carbocyclic compound) | carbocyclic compound |
| P279 | subclass of | ... | Q23305225 (perfluorocarbon) | perfluorocarbon |
| P279 | subclass of | ... | Q55692896 (monocyclic compound) | monocyclic compound |
| P4842 | ASHRAE refrigerant number | C318 |
| P11931 | CAMEO Chemicals ID | 4104 |
| P231 | CAS Registry Number | 115-25-3 |
| P683 | ChEBI ID | 31007 |
| P592 | ChEMBL ID | CHEMBL444147 |
| P661 | ChemSpider ID | 13846040 |
| P8494 | DSSTOX compound identifier | DTXCID7021811 |
| P3117 | DSSTox substance ID | DTXSID9041811 |
| P628 | E number | E946 |
| P232 | EC number | 204-075-2 |
| P2566 | ECHA Substance Infocard ID | 100.003.705 |
| P646 | Freebase ID | /m/088xgj |
| P1578 | Gmelin number | 131113 |
| P2057 | Human Metabolome Database ID | HMDB0031292 |
| P234 | InChI | InChI=1S/C4F8/c5-1(6)2(7,8)4(11,12)3(1,9)10 |
| P235 | InChIKey | BCCOBQSFUDVTJQ-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2777865166 |
| P9405 | NMRShiftDB structure ID | 60008715 |
| P662 | PubChem CID | 8263 |
| P1579 | Reaxys registry number | 1909266 |
| P2877 | SureChEMBL ID | 24521 |
| P11089 | UniChem compound ID | 566496 |
| P652 | UNII | V9P1D0A21K |
| P679 | ZVG number | 510650 |
Why not click here or view trends?
log id: 2867719