Wikidata entity: Q4134929
C₃₆H₃₀Sn₂ (P274)
Quantities
| P2067 | mass | 702.03914036 |
| P233 | canonical SMILES | String | C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)C3=CC=CC=C3 | ??? |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q1096 (tin) | tin |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1064-10-4 |
| P661 | ChemSpider ID | 21169835 |
| P661 | ChemSpider ID | 4885683 |
| P8494 | DSSTOX compound identifier | DTXCID9033008 |
| P3117 | DSSTox substance ID | DTXSID4074439 |
| P232 | EC number | 213-902-6 |
| P2566 | ECHA Substance Infocard ID | 100.012.639 |
| P2671 | Google Knowledge Graph ID | /g/11vj7k6nd |
| P234 | InChI | InChI=1S/6C6H5.2Sn/c6*1-2-4-6-5-3-1;;/h6*1-5H;; |
| P235 | InChIKey | UAPQJVJCJITJET-UHFFFAOYSA-N |
| P2840 | NSC number | 22333 |
| P662 | PubChem CID | 6327129 |
| P662 | PubChem CID | 101639641 |
| P662 | PubChem CID | 50930996 |
| P2877 | SureChEMBL ID | 241539 |
| P2877 | SureChEMBL ID | 29858810 |
| P652 | UNII | 7MC26M1VE9 |
| P679 | ZVG number | 490306 |
Why not click here or view trends?
log id: 4617540