Wikidata entity: Q415433
C₁₄H₁₄N₂ (P274)
Quantities
| P4250 | defined daily dose | 0.4 |
| P2067 | mass | 210.115698 |
| P3780 | active ingredient in | ... | Q47520988 (AK-Con) | AK-Con |
| P3780 | active ingredient in | ... | Q48828170 (Vasocon) | Vasocon |
| P3780 | active ingredient in | ... | Q48829139 (Naphcon) | Naphcon |
| P233 | canonical SMILES | String | C1CN=C(N1)CC2=CC=CC3=CC=CC=C32 | ??? |
| P373 | Commons category | String | Naphazoline | ??? |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Naphazoline.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q948806 (hyperaemia) | hyperaemia |
| P2175 | medical condition treated | ... | Q114085 (rhinitis) | rhinitis |
| P2175 | medical condition treated | ... | Q183344 (sinusitis) | sinusitis |
| P129 | physically interacts with | ... | Q21991513 (Trace amine-associated receptor 4) | Trace amine-associated receptor 4 |
| P6802 | related image | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/%D0%9D%D0%90%D0%A4%D0%A2%D0%98%D0%97%D0%98%D0%9D.%20%D0%9A%D0%B0%D0%BF%D0%BB%D0%B8%20%D0%BD%D0%B0%D0%B7%D0%B0%D0%BB%D1%8C%D0%BD%D1%8B%D0%B5%20%28%D0%9D%D0%B0%D1%84%D0%B0%D0%B7%D0%BE%D0%BB%D0%B8%D0%BD%200%2C1%20%25%29.%20%D0%A4%D0%BE%D1%82%D0%BE%20%D0%90.%20%D0%A9%D0%B5%D0%BA%D0%B8%D0%BD%D0%BE%D0%B2%D0%B0%20%283%29.jpg | ??? |
| P279 | subclass of | ... | Q193430 (heterocyclic compound) | heterocyclic compound |
| P2868 | subject has role | ... | Q4734924 (alpha-adrenergic agonist) | alpha-adrenergic agonist |
| P2868 | subject has role | ... | Q430719 (decongestant) | decongestant |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | naphazoline | ??? |
| P267 | ATC code | R01AA08 |
| P267 | ATC code | R01AB02 |
| P267 | ATC code | S01GA01 |
| P231 | CAS Registry Number | 835-31-4 |
| P683 | ChEBI ID | 93363 |
| P592 | ChEMBL ID | CHEMBL761 |
| P661 | ChemSpider ID | 4283 |
| P715 | DrugBank ID | DB06711 |
| P11198 | DrugCentral ID | 3369 |
| P8494 | DSSTOX compound identifier | DTXCID90198485 |
| P3117 | DSSTox substance ID | DTXSID3048449 |
| P232 | EC number | 212-641-5 |
| P2566 | ECHA Substance Infocard ID | 100.011.492 |
| P4746 | Elhuyar ZTH ID | 028499 |
| P646 | Freebase ID | /m/06zb0_ |
| P595 | Guide to Pharmacology Ligand ID | 5509 |
| P2057 | Human Metabolome Database ID | HMDB0015656 |
| P234 | InChI | InChI=1S/C14H14N2/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14/h1-7H,8-10H2,(H,15,16) |
| P235 | InChIKey | CNIIGCLFLJGOGP-UHFFFAOYSA-N |
| P5063 | Interlingual Index ID | i56496 |
| P665 | KEGG ID | D08253 |
| P6689 | MassBank accession ID | MSBNK-Waters-WA002682 |
| P6689 | MassBank accession ID | MSBNK-Waters-WA002683 |
| P6689 | MassBank accession ID | MSBNK-Waters-WA002684 |
| P6689 | MassBank accession ID | MSBNK-Waters-WA002685 |
| P6694 | MeSH concept ID | M0014455 |
| P486 | MeSH descriptor ID | D009278 |
| P672 | MeSH tree code | D03.383.129.308.585 |
| P6366 | Microsoft Academic ID (discontinued) | 2776101175 |
| P2115 | NDF-RT ID | N0000147941 |
| P4235 | PatientsLikeMe treatment ID | naphazoline |
| P11199 | Probes And Drugs ID | PD009276 |
| P662 | PubChem CID | 4436 |
| P3345 | RxNorm CUI | 7247 |
| P2877 | SureChEMBL ID | 34532 |
| P2892 | UMLS CUI | C0027373 |
| P11089 | UniChem compound ID | 34127 |
| P652 | UNII | H231GF11BV |
| P11143 | WikiProjectMed ID | Naphazoline |
| P8814 | WordNet 3.1 Synset ID | 03812592-n |
Why not click here or view trends?
log id: 6216830