Wikidata entity: Q415709
C₈H₉NO₅ (P274)
Quantities
| P2067 | mass | 199.048 |
| P233 | canonical SMILES | String | C1C2N(C1=O)C(C(=CCO)O2)C(=O)O | ??? |
| P373 | Commons category | String | Clavulanic acid | ??? |
| P703 | found in taxon | ... | Q7623381 (Streptomyces clavuligerus) | Streptomyces clavuligerus |
| P703 | found in taxon | ... | Q18385815 (Streptomyces cattleya) | Streptomyces cattleya |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1[C@@H]2N(C1=O)[C@H](/C(=C/CO)/O2)C(=O)O | ??? |
| P2175 | medical condition treated | ... | Q223254 (otitis media) | otitis media |
| P2175 | medical condition treated | ... | Q221668 (urinary tract infection) | urinary tract infection |
| P3489 | pregnancy category | ... | Q3679232 (Australian pregnancy category B1) | Australian pregnancy category B1 |
| P3489 | pregnancy category | ... | Q28123616 (US pregnancy category B) | US pregnancy category B |
| P636 | route of administration | ... | Q285166 (oral administration) | oral administration |
| P636 | route of administration | ... | Q640448 (intravenous infusion and defusion) | intravenous infusion and defusion |
| P3364 | stereoisomer of | ... | Q27110175 (Isoclavulanic acid) | Isoclavulanic acid |
| P3364 | stereoisomer of | ... | Q27166398 ((2R,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid) | (2R,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| P279 | subclass of | ... | Q70702 (alkaloid) | alkaloid |
| P2868 | subject has role | ... | Q310286 (beta-lactamase inhibitors) | beta-lactamase inhibitors |
| P2868 | subject has role | ... | Q804539 (bactericide) | bactericide |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | clavulanic acid | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | acidum clavulanicum | ??? |
| P8072 | CAB ID | 60862 |
| P231 | CAS Registry Number | 58001-44-8 |
| P683 | ChEBI ID | 48947 |
| P592 | ChEMBL ID | CHEMBL777 |
| P661 | ChemSpider ID | 4444466 |
| P715 | DrugBank ID | DB00766 |
| P11198 | DrugCentral ID | 669 |
| P8494 | DSSTOX compound identifier | DTXCID702830 |
| P3117 | DSSTox substance ID | DTXSID2022830 |
| P232 | EC number | 261-069-2 |
| P2566 | ECHA Substance Infocard ID | 100.055.500 |
| P646 | Freebase ID | /m/05sxzz |
| P227 | GND ID | 4406836-0 |
| P595 | Guide to Pharmacology Ligand ID | 11128 |
| P2057 | Human Metabolome Database ID | HMDB0014904 |
| P4168 | IEDB Epitope ID | 117130 |
| P234 | InChI | InChI=1S/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1-/t6-,7-/m1/s1 |
| P235 | InChIKey | HZZVJAQRINQKSD-PBFISZAISA-N |
| P665 | KEGG ID | D07711 |
| P2064 | KNApSAcK ID | C00018091 |
| P486 | MeSH descriptor ID | D019818 |
| P672 | MeSH tree code | D02.065.589.099.374.160 |
| P672 | MeSH tree code | D03.633.100.300.374.160 |
| P6366 | Microsoft Academic ID (discontinued) | 2779454058 |
| P2115 | NDF-RT ID | N0000147772 |
| P10283 | OpenAlex ID | C2776205632 |
| P10283 | OpenAlex ID | C2779454058 |
| P3636 | PDB ligand ID | J01 |
| P638 | PDB structure ID | 2XH9 |
| P638 | PDB structure ID | 2XFS |
| P638 | PDB structure ID | 2JAP |
| P638 | PDB structure ID | 2XF3 |
| P11199 | Probes And Drugs ID | PD009731 |
| P662 | PubChem CID | 5280980 |
| P1579 | Reaxys registry number | 787059 |
| P3345 | RxNorm CUI | 21216 |
| P3345 | RxNorm CUI | 48203 |
| P2877 | SureChEMBL ID | 6093 |
| P2892 | UMLS CUI | C0110038 |
| P11089 | UniChem compound ID | 307121 |
| P652 | UNII | 23521W1S24 |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 4948 |
Why not click here or view trends?
log id: 2198849