Wikidata entity: Q415972
C₁₆H₂₂FNO (P274)
Quantities
| P2067 | mass | 263.168543 |
| P233 | canonical SMILES | String | CC1CCN(CC1)CCCC(=O)C2=CC=C(C=C2)F | ??? |
| P373 | Commons category | String | Melperone | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Melperone%203D%20ball.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q177190 (sleep disorder) | sleep disorder |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q208144 (antipsychotics) | antipsychotics |
| P267 | ATC code | N05AD03 |
| P231 | CAS Registry Number | 3575-80-2 |
| P683 | ChEBI ID | 93626 |
| P592 | ChEMBL ID | CHEMBL1531134 |
| P661 | ChemSpider ID | 14646 |
| P715 | DrugBank ID | DB09224 |
| P11198 | DrugCentral ID | 1677 |
| P8494 | DSSTOX compound identifier | DTXCID603298 |
| P3117 | DSSTox substance ID | DTXSID0023298 |
| P232 | EC number | 609-173-2 |
| P2566 | ECHA Substance Infocard ID | 100.107.027 |
| P646 | Freebase ID | /m/026vfyw |
| P2671 | Google Knowledge Graph ID | /g/11h3_88x2p |
| P2057 | Human Metabolome Database ID | HMDB0254429 |
| P234 | InChI | InChI=1S/C16H22FNO/c1-13-8-11-18(12-9-13)10-2-3-16(19)14-4-6-15(17)7-5-14/h4-7,13H,2-3,8-12H2,1H3 |
| P235 | InChIKey | DKMFBWQBDIGMHM-UHFFFAOYSA-N |
| P665 | KEGG ID | D07309 |
| P6689 | MassBank accession ID | SM849401 |
| P486 | MeSH descriptor ID | C008522 |
| P6366 | Microsoft Academic ID (discontinued) | 2775931706 |
| P11199 | Probes And Drugs ID | PD008997 |
| P662 | PubChem CID | 15387 |
| P3345 | RxNorm CUI | 29961 |
| P4964 | SPLASH | splash10-0300-0940000000-5f2b3e89368f333f4076 |
| P2877 | SureChEMBL ID | 146287 |
| P11089 | UniChem compound ID | 696293 |
| P652 | UNII | J8WA3K39B7 |
Why not click here or view trends?
log id: 2111131