Wikidata entity: Q4162487
C₁₂H₁₀Sn (P274)
Quantities
| P2067 | mass | 273.980445 |
| P233 | canonical SMILES | String | C1=CC=C(C=C1)[Sn]C2=CC=CC=C2 | ??? |
| P462 | color | ... | Q943 (yellow) | yellow |
| P462 | color | ... | Q3142 (red) | red |
| P373 | Commons category | String | Diphenyltin | ??? |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q1096 (tin) | tin |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 6381-06-2 |
| P661 | ChemSpider ID | 63706 |
| P2671 | Google Knowledge Graph ID | /g/11vj7l_9x |
| P234 | InChI | InChI=1S/2C6H5.Sn/c2*1-2-4-6-5-3-1;/h2*1-5H; |
| P235 | InChIKey | KUCPUSUXIGWHFB-UHFFFAOYSA-N |
| P2840 | NSC number | 162819 |
| P662 | PubChem CID | 70535 |
| P662 | PubChem CID | 101653054 |
| P2877 | SureChEMBL ID | 218376 |
| P11089 | UniChem compound ID | 23162739 |
Why not click here or view trends?
log id: 4734209