Wikidata entity: Q417762
C₁₈₄H₂₈₂N₅₀O₆₀S (P274)
Quantities
| P4250 | defined daily dose | 0.286 |
| P2067 | mass | 4184.027307224008 |
| P3780 | active ingredient in | ... | Q29004940 (Bydureon) | Bydureon |
| P3780 | active ingredient in | ... | Q29004942 (Byetta) | Byetta |
| P233 | canonical SMILES | String | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(NC(=O)C(C)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CCSC)NC(=O)C(CCC(N)=O)NC(=O)C(CCCCN)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)CNC(=O)C(N)Cc1cnc[nH]1)C(C)O)C(C)O)C(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)NCC(=O)NCC(=O)N1CCCC1C(=O)NC(CO)C(=O)NC(CO)C(=O)NCC(=O)NC(C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NC(CO)C(N)=O | ??? |
| P373 | Commons category | String | Exenatide | ??? |
| P703 | found in taxon | ... | Q207058 (Gila monster) | Gila monster |
| P1552 | has characteristic | ... | Q679692 (biopharmaceutical) | biopharmaceutical |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Exenatide%20PDB%3D7MLL.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@@H](N)Cc1cnc[nH]1)C(C)O)C(C)O)C(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(N)=O | ??? |
| P3493 | legal status (medicine) | ... | Q879952 (boxed warning) | boxed warning |
| P2175 | medical condition treated | ... | Q124407 (type-1 diabetes) | type-1 diabetes |
| P2175 | medical condition treated | ... | Q2661464 (glucose intolerance) | glucose intolerance |
| P2175 | medical condition treated | ... | Q32147145 (maturity-onset diabetes of the young type 2) | maturity-onset diabetes of the young type 2 |
| P1748 | NCI Thesaurus ID | String | C65611 | ??? |
| P129 | physically interacts with | ... | Q5572289 (Glucagon like peptide 1 receptor) | Glucagon like peptide 1 receptor |
| P636 | route of administration | ... | Q2035485 (subcutaneous injection) | subcutaneous injection |
| P279 | subclass of | ... | Q5572286 (glucagon-like peptide-1 agonist) | glucagon-like peptide-1 agonist |
| P279 | subclass of | ... | Q104631433 (synthetic peptide) | synthetic peptide |
| P2868 | subject has role | ... | Q575062 (anti-diabetic medication) | anti-diabetic medication |
| P2868 | subject has role | ... | Q1420402 (incretins) | incretins |
| P2868 | subject has role | ... | Q5572286 (glucagon-like peptide-1 agonist) | glucagon-like peptide-1 agonist |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | exenatide | ??? |
| P267 | ATC code | A10BJ01 |
| P267 | ATC code | A10BX04 |
| P5019 | Brockhaus Enzyklopädie online ID | exenatid |
| P231 | CAS Registry Number | 141758-74-9 |
| P683 | ChEBI ID | 64073 |
| P592 | ChEMBL ID | CHEMBL414357 |
| P661 | ChemSpider ID | 17314184 |
| P9272 | DeCS ID | 57573 |
| P715 | DrugBank ID | DB01276 |
| P11198 | DrugCentral ID | 1123 |
| P8494 | DSSTOX compound identifier | DTXCID001323055 |
| P3117 | DSSTox substance ID | DTXSID9040475 |
| P232 | EC number | 686-356-3 |
| P2566 | ECHA Substance Infocard ID | 100.212.123 |
| P1417 | Encyclopædia Britannica Online ID | topic/exenatide |
| P646 | Freebase ID | /m/093_zf |
| P595 | Guide to Pharmacology Ligand ID | 1135 |
| P2062 | HSDB ID | 7789 |
| P235 | InChIKey | HTQBXNHDCUEHJF-URRANESESA-N |
| P235 | InChIKey | HTQBXNHDCUEHJF-XWLPCZSASA-N |
| P665 | KEGG ID | D04121 |
| P10245 | MedlinePlus drug identifier | a605034 |
| P486 | MeSH descriptor ID | D000077270 |
| P672 | MeSH tree code | D12.644.187 |
| P672 | MeSH tree code | D20.888.300 |
| P672 | MeSH tree code | D23.946.833.300 |
| P6366 | Microsoft Academic ID (discontinued) | 2780533449 |
| P950 | National Library of Spain SpMaBN ID (BNE v1.0) | XX5161058 |
| P2115 | NDF-RT ID | N0000023104 |
| P10283 | OpenAlex ID | C2780533449 |
| P4235 | PatientsLikeMe treatment ID | exenatide |
| P11199 | Probes And Drugs ID | PD071714 |
| P662 | PubChem CID | 45588096 |
| P662 | PubChem CID | 16157882 |
| P662 | PubChem CID | 163192105 |
| P662 | PubChem CID | 56927919 |
| P662 | PubChem CID | 56947125 |
| P662 | PubChem CID | 91935542 |
| P3345 | RxNorm CUI | 60548 |
| P2877 | SureChEMBL ID | 29352797 |
| P2877 | SureChEMBL ID | 29827241 |
| P2877 | SureChEMBL ID | 14634818 |
| P2877 | SureChEMBL ID | 29350782 |
| P2877 | SureChEMBL ID | 30947451 |
| P11143 | WikiProjectMed ID | Exenatide |
Why not click here or view trends?
log id: 5470803