Wikidata entity: Q418237
C₁₆H₁₆O₅ (P274)
Quantities
| P2067 | mass | 288.1 |
| P233 | canonical SMILES | String | CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C | ??? |
| P373 | Commons category | String | Alkannin | ??? |
| P703 | found in taxon | ... | Q856964 (Alkanna tinctoria) | Alkanna tinctoria |
| P703 | found in taxon | ... | Q2863294 (Arnebia hispidissima) | Arnebia hispidissima |
| P703 | found in taxon | ... | Q12847033 (Arnebia decumbens) | Arnebia decumbens |
| P703 | found in taxon | ... | Q15225733 (Arnebia euchroma) | Arnebia euchroma |
| P703 | found in taxon | ... | Q15572388 (Alkanna cappadocica) | Alkanna cappadocica |
| P703 | found in taxon | ... | Q15592453 (Lithospermum erythrorhizon) | Lithospermum erythrorhizon |
| P366 | has use | ... | Q753009 (food coloring) | food coloring |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Alkannin%203D%20spacefill.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC(=CC[C@@H](C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C | ??? |
| P1582 | natural product of taxon | ... | Q856964 (Alkanna tinctoria) | Alkanna tinctoria |
| P3364 | stereoisomer of | ... | Q27155024 (anchusin) | anchusin |
| P279 | subclass of | ... | Q105178326 (shikalkin) | shikalkin |
| P279 | subclass of | ... | Q108485826 (2,6-dimethyloctane monoterpenoid) | 2,6-dimethyloctane monoterpenoid |
| P279 | subclass of | ... | Q109559439 (biogenic naphthochinone) | biogenic naphthochinone |
| P231 | CAS Registry Number | 517-88-4 |
| P683 | ChEBI ID | 2578 |
| P592 | ChEMBL ID | CHEMBL28457 |
| P661 | ChemSpider ID | 65430 |
| P3117 | DSSTox substance ID | DTXSID201029621 |
| P628 | E number | E103 |
| P232 | EC number | 208-245-7 |
| P2566 | ECHA Substance Infocard ID | 100.007.497 |
| P646 | Freebase ID | /m/0ds1qy5 |
| P234 | InChI | InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3/t10-/m0/s1 |
| P235 | InChIKey | NEZONWMXZKDMKF-JTQLQIEISA-N |
| P665 | KEGG ID | C10292 |
| P2064 | KNApSAcK ID | C00002787 |
| P6689 | MassBank accession ID | MSBNK-Univ_Toyama-TY000058 |
| P6366 | Microsoft Academic ID (discontinued) | 2779309452 |
| P2840 | NSC number | 407295 |
| P2840 | NSC number | 94524 |
| P7305 | Online PWN Encyclopedia ID | 3869186 |
| P11199 | Probes And Drugs ID | PD098730 |
| P662 | PubChem CID | 72521 |
| P5076 | Römpp online ID | RD-01-01461 |
| P4964 | SPLASH | splash10-000i-0090000000-cfa1da28e0428731fd8b |
| P2877 | SureChEMBL ID | 33968 |
| P11089 | UniChem compound ID | 514870 |
| P652 | UNII | 075CRZ9995 |
Why not click here or view trends?
log id: 6211150