Wikidata entity: Q418571
C₁₃H₁₂Cl₂O₄ (P274)
Quantities
| P4250 | defined daily dose | 50 |
| P2067 | mass | 302.011 |
| P233 | canonical SMILES | String | CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)O)Cl)Cl | ??? |
| P373 | Commons category | String | Etacrynic acid | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q41861 (arterial hypertension) | arterial hypertension |
| P2175 | medical condition treated | ... | Q147778 (liver cirrhosis) | liver cirrhosis |
| P2175 | medical condition treated | ... | Q486485 (anasarka) | anasarka |
| P2175 | medical condition treated | ... | Q504790 (nephrotic syndrome) | nephrotic syndrome |
| P2175 | medical condition treated | ... | Q736715 (chronic renal insufficiency) | chronic renal insufficiency |
| P2175 | medical condition treated | ... | Q857667 (pulmonary edema) | pulmonary edema |
| P2175 | medical condition treated | ... | Q929737 (liver disease) | liver disease |
| P2175 | medical condition treated | ... | Q19000661 (congestive heart failure) | congestive heart failure |
| P636 | route of administration | ... | Q285166 (oral administration) | oral administration |
| P279 | subclass of | ... | Q16691995 (aromatic ketone) | aromatic ketone |
| P279 | subclass of | ... | Q43305851 (phenol ether) | phenol ether |
| P279 | subclass of | ... | Q47147773 (monocarboxylic acid) | monocarboxylic acid |
| P279 | subclass of | ... | Q72701465 (dichlorobenzene derivative) | dichlorobenzene derivative |
| P2868 | subject has role | ... | Q200656 (diuretic) | diuretic |
| P2868 | subject has role | ... | Q427492 (enzyme inhibitor) | enzyme inhibitor |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | etacrynic acid | ??? |
| P267 | ATC code | C03CC01 |
| P11931 | CAMEO Chemicals ID | 20351 |
| P231 | CAS Registry Number | 58-54-8 |
| P683 | ChEBI ID | 4876 |
| P592 | ChEMBL ID | CHEMBL456 |
| P661 | ChemSpider ID | 3163 |
| P715 | DrugBank ID | DB00903 |
| P11198 | DrugCentral ID | 1071 |
| P8494 | DSSTOX compound identifier | DTXCID205257 |
| P3117 | DSSTox substance ID | DTXSID3025257 |
| P232 | EC number | 200-384-1 |
| P2566 | ECHA Substance Infocard ID | 100.000.349 |
| P646 | Freebase ID | /m/07fjfr |
| P595 | Guide to Pharmacology Ligand ID | 7179 |
| P2062 | HSDB ID | 2136 |
| P2057 | Human Metabolome Database ID | HMDB0015039 |
| P234 | InChI | InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) |
| P235 | InChIKey | AVOLMBLBETYQHX-UHFFFAOYSA-N |
| P665 | KEGG ID | D00313 |
| P10245 | MedlinePlus drug identifier | a682857 |
| P6694 | MeSH concept ID | M0007812 |
| P486 | MeSH descriptor ID | D004976 |
| P672 | MeSH tree code | D02.241.081.018.386.682.300 |
| P672 | MeSH tree code | D02.241.511.316.682.200 |
| P6366 | Microsoft Academic ID (discontinued) | 2780458438 |
| P6366 | Microsoft Academic ID (discontinued) | 2908835406 |
| P2115 | NDF-RT ID | N0000146283 |
| P2840 | NSC number | 85791 |
| P2840 | NSC number | 757026 |
| P4235 | PatientsLikeMe treatment ID | ethacrynic-acid |
| P3636 | PDB ligand ID | EAA |
| P638 | PDB structure ID | 1GSF |
| P638 | PDB structure ID | 3N9J |
| P638 | PDB structure ID | 3DGQ |
| P638 | PDB structure ID | 3HJO |
| P638 | PDB structure ID | 3GSS |
| P638 | PDB structure ID | 2GSS |
| P638 | PDB structure ID | 11GS |
| P638 | PDB structure ID | 3KM6 |
| P638 | PDB structure ID | 1GSE |
| P638 | PDB structure ID | 3KMO |
| P11199 | Probes And Drugs ID | PD002338 |
| P662 | PubChem CID | 3278 |
| P1579 | Reaxys registry number | 1915060 |
| P3345 | RxNorm CUI | 4109 |
| P2877 | SureChEMBL ID | 26353 |
| P2892 | UMLS CUI | C0014963 |
| P11089 | UniChem compound ID | 211388 |
| P652 | UNII | M5DP350VZV |
| P11143 | WikiProjectMed ID | Etacrynic acid |
Why not click here or view trends?
log id: None