Wikidata entity: Q418611
C₂₇H₂₂Cl₂N₄ (P274)
Quantities
| P4250 | defined daily dose | 0.1 |
| P2067 | mass | 472.122152 |
| P233 | canonical SMILES | String | CC(C)N=C1C=C2C(=NC3=CC=CC=C3N2C4=CC=C(C=C4)Cl)C=C1NC5=CC=C(C=C5)Cl | ??? |
| P373 | Commons category | String | Clofazimine | ??? |
| P703 | found in taxon | ... | Q3975996 (Streptomyces hygroscopicus) | Streptomyces hygroscopicus |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Clofazimine%203D%20ball.png | ??? |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Clofazimine%203D%20spacefill.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC(C)/N=C/1\C=C2N(C3=CC=CC=C3N=C2C=C1NC4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl | ??? |
| P8026 | LiverTox likelihood score | ... | Q83284667 (LiverTox toxicity likelihood category E) | LiverTox toxicity likelihood category E |
| P1987 | MCN code | String | 2933.99.93 | ??? |
| P2175 | medical condition treated | ... | Q1526459 (pyoderma gangrenosum) | pyoderma gangrenosum |
| P2175 | medical condition treated | ... | Q36956 (leprosy) | leprosy |
| P2175 | medical condition treated | ... | Q4944687 (borderline leprosy) | borderline leprosy |
| P2175 | medical condition treated | ... | Q6527832 (lepromatous leprosy) | lepromatous leprosy |
| P2175 | medical condition treated | ... | Q6946984 (Mycobacterium avium-intracellulare infection) | Mycobacterium avium-intracellulare infection |
| P279 | subclass of | ... | Q105302601 ((E/Z)-clofazimine) | (E/Z)-clofazimine |
| P2868 | subject has role | ... | Q35456 (essential medicine) | essential medicine |
| P2868 | subject has role | ... | Q804539 (bactericide) | bactericide |
| P2868 | subject has role | ... | Q4118287 (DNA polymerase inhibitors) | DNA polymerase inhibitors |
| P2868 | subject has role | ... | Q6527835 (leprostatic agent) | leprostatic agent |
| P2868 | subject has role | ... | Q581996 (anti-inflammatory agent) | anti-inflammatory agent |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | clofazimine | ??? |
| P267 | ATC code | J04BA01 |
| P8072 | CAB ID | 33650 |
| P231 | CAS Registry Number | 2030-63-9 |
| P683 | ChEBI ID | 3749 |
| P592 | ChEMBL ID | CHEMBL1369407 |
| P592 | ChEMBL ID | CHEMBL1292 |
| P661 | ChemSpider ID | 21159573 |
| P9272 | DeCS ID | 3015 |
| P715 | DrugBank ID | DB00845 |
| P8494 | DSSTOX compound identifier | DTXCID302839 |
| P3117 | DSSTox substance ID | DTXSID7022839 |
| P232 | EC number | 217-980-2 |
| P2566 | ECHA Substance Infocard ID | 100.016.347 |
| P9635 | electronic Essential Medicines List medicine ID | 292 |
| P1417 | Encyclopædia Britannica Online ID | topic/clofazimine |
| P646 | Freebase ID | /m/095p8_ |
| P595 | Guide to Pharmacology Ligand ID | 9184 |
| P2057 | Human Metabolome Database ID | HMDB0014983 |
| P234 | InChI | InChI=1S/C27H22Cl2N4/c1-17(2)30-24-16-27-25(15-23(24)31-20-11-7-18(28)8-12-20)32-22-5-3-4-6-26(22)33(27)21-13-9-19(29)10-14-21/h3-17,31H,1-2H3/b30-24+ |
| P235 | InChIKey | WDQPAMHFFCXSNU-UHFFFAOYSA-N |
| P665 | KEGG ID | D00278 |
| P665 | KEGG ID | C06915 |
| P7830 | LiverTox ID | Clofazimine |
| P486 | MeSH descriptor ID | D002991 |
| P672 | MeSH tree code | D03.633.300.704.353 |
| P6366 | Microsoft Academic ID (discontinued) | 2776297342 |
| P2115 | NDF-RT ID | N0000147624 |
| P2840 | NSC number | 141046 |
| P2840 | NSC number | 759283 |
| P10283 | OpenAlex ID | C2776297342 |
| P11199 | Probes And Drugs ID | PD003044 |
| P662 | PubChem CID | 2794 |
| P1579 | Reaxys registry number | 8168151 |
| P3345 | RxNorm CUI | 2592 |
| P2877 | SureChEMBL ID | 26758 |
| P11089 | UniChem compound ID | 919294 |
| P652 | UNII | D959AE5USF |
| P11143 | WikiProjectMed ID | Clofazimine |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 2248 |
Why not click here or view trends?
log id: 4269014