| P233 |
canonical SMILES |
String |
CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3C4N(C3=O)C(C(S4)(C)C)C(=O)O |
??? |
| P373 |
Commons category |
String |
Oxacillin |
??? |
| P703 |
found in taxon |
... |
Q842207 (Pseudoalteromonas) |
Pseudoalteromonas |
| P703 |
found in taxon |
... |
Q986006 (Liquidambar formosana) |
Liquidambar formosana |
| P703 |
found in taxon |
... |
Q2591881 (Cordyceps farinosa) |
Cordyceps farinosa |
| P703 |
found in taxon |
... |
Q7254196 (Pseudallescheria boydii) |
Pseudallescheria boydii |
| P366 |
has use |
... |
Q12140 (medication) |
medication |
| P31 |
instance of |
... |
Q113145171 (type of chemical entity) |
type of chemical entity |
| P2017 |
isomeric SMILES |
String |
CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)O |
??? |
| P2175 |
medical condition treated |
... |
Q34879 (staphylococcal infection) |
staphylococcal infection |
| P2175 |
medical condition treated |
... |
Q183134 (sepsis) |
sepsis |
| P2175 |
medical condition treated |
... |
Q221668 (urinary tract infection) |
urinary tract infection |
| P2175 |
medical condition treated |
... |
Q876887 (cellulitis) |
cellulitis |
| P2175 |
medical condition treated |
... |
Q938983 (osteomyelitis) |
osteomyelitis |
| P2175 |
medical condition treated |
... |
Q2450598 (infective endocarditis) |
infective endocarditis |
| P2175 |
medical condition treated |
... |
Q2622199 (upper respiratory tract infection) |
upper respiratory tract infection |
| P2175 |
medical condition treated |
... |
Q3678510 (bacterial meningitis) |
bacterial meningitis |
| P2175 |
medical condition treated |
... |
Q18478450 (postoperative complications) |
postoperative complications |
| P279 |
subclass of |
... |
Q12190 (penicillin) |
penicillin |
| P279 |
subclass of |
... |
Q193430 (heterocyclic compound) |
heterocyclic compound |
| P2868 |
subject has role |
... |
Q12187 (antibiotic) |
antibiotic |
| P2868 |
subject has role |
... |
Q804539 (bactericide) |
bactericide |
| P12081 |
WHO Aware Classification |
... |
Q122924881 (access) |
access |
| P2275 |
World Health Organisation international non-proprietary name |
Monolingualtext |
oxacillin |
??? |
| P267 | ATC code | J01CF04 |
| P8072 | CAB ID | 232683 |
| P231 | CAS Registry Number | 66-79-5 |
| P683 | ChEBI ID | 7809 |
| P592 | ChEMBL ID | CHEMBL819 |
| P661 | ChemSpider ID | 5961 |
| P715 | DrugBank ID | DB00713 |
| P11198 | DrugCentral ID | 2006 |
| P8494 | DSSTOX compound identifier | DTXCID403397 |
| P3117 | DSSTox substance ID | DTXSID8023397 |
| P232 | EC number | 200-635-5 |
| P2566 | ECHA Substance Infocard ID | 100.000.577 |
| P646 | Freebase ID | /m/0c6zhc |
| P595 | Guide to Pharmacology Ligand ID | 10943 |
| P2057 | Human Metabolome Database ID | HMDB0014851 |
| P4168 | IEDB Epitope ID | 181859 |
| P234 | InChI | InChI=1S/C19H19N3O5S/c1-9-11(12(21-27-9)10-7-5-4-6-8-10)15(23)20-13-16(24)22-14(18(25)26)19(2,3)28-17(13)22/h4-8,13-14,17H,1-3H3,(H,20,23)(H,25,26)/t13-,14+,17-/m1/s1 |
| P235 | InChIKey | UWYHMGVUTGAWSP-JKIFEVAISA-N |
| P5063 | Interlingual Index ID | i56854 |
| P665 | KEGG ID | C07334 |
| P665 | KEGG ID | D08307 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320701 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320702 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320703 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320704 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320705 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320706 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320707 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320708 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320709 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320751 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320752 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320753 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320754 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320755 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320756 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320757 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320758 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ320759 |
| P10245 | MedlinePlus drug identifier | a685020 |
| P6694 | MeSH concept ID | M0015618 |
| P486 | MeSH descriptor ID | D010068 |
| P672 | MeSH tree code | D02.065.589.099.750.625 |
| P672 | MeSH tree code | D02.886.108.750.625 |
| P672 | MeSH tree code | D03.633.100.300.750.625 |
| P6366 | Microsoft Academic ID (discontinued) | 2775997066 |
| P2115 | NDF-RT ID | N0000147953 |
| P4235 | PatientsLikeMe treatment ID | oxacillin |
| P11199 | Probes And Drugs ID | PD010065 |
| P662 | PubChem CID | 6196 |
| P1579 | Reaxys registry number | 1093589 |
| P3345 | RxNorm CUI | 7773 |
| P4964 | SPLASH | splash10-00di-8890000000-4a47690fda1171ea9191 |
| P4964 | SPLASH | splash10-00e9-9200000000-4bfc7a848a77bc668c0a |
| P4964 | SPLASH | splash10-00e9-9410000000-b5c01a94c4b433924722 |
| P4964 | SPLASH | splash10-00e9-9530000000-81bb9ec609f6a7e8c6dd |
| P4964 | SPLASH | splash10-014i-9000000000-3661f69f0fee17d6a499 |
| P4964 | SPLASH | splash10-014i-9000000000-f568ba02b1720f9fd951 |
| P4964 | SPLASH | splash10-01b9-9000000000-927fa2d2be3c33adb44c |
| P4964 | SPLASH | splash10-03di-0900000000-92b22bc2f96b5f612718 |
| P4964 | SPLASH | splash10-03di-1900000000-4dceea173f6174da433d |
| P4964 | SPLASH | splash10-03di-3900000000-3ee73f5cb610870dbdb1 |
| P4964 | SPLASH | splash10-03dl-0920000000-69978fc6eeaa10c71f81 |
| P4964 | SPLASH | splash10-0a4i-0090000000-79c009ac45201875c809 |
| P4964 | SPLASH | splash10-0a4i-1290000000-4d46550a2c9c9f77458a |
| P4964 | SPLASH | splash10-0ikj-9800000000-fbc9b294222787b35a80 |
| P4964 | SPLASH | splash10-0k92-9200000000-a405a812cf5f1a2f17e1 |
| P4964 | SPLASH | splash10-0udi-9000000000-21eb1aa369a09320f715 |
| P4964 | SPLASH | splash10-0udj-9100000000-451b59b916ee627de317 |
| P2877 | SureChEMBL ID | 3817 |
| P2892 | UMLS CUI | C0029983 |
| P11089 | UniChem compound ID | 172396 |
| P652 | UNII | UH95VD7V76 |
| P11143 | WikiProjectMed ID | Oxacillin |
| P8814 | WordNet 3.1 Synset ID | 03873033-n |