| P3780 |
active ingredient in |
... |
Q47521192 (Aromasin) |
Aromasin |
| P233 |
canonical SMILES |
String |
CC12CCC3C(C1CCC2=O)CC(=C)C4=CC(=O)C=CC34C |
??? |
| P373 |
Commons category |
String |
Exemestane |
??? |
| P366 |
has use |
... |
Q12140 (medication) |
medication |
| P8224 |
image of molecular model or crystal lattice model |
CommonsMedia |
http://commons.wikimedia.org/wiki/Special:FilePath/Exemestano.png |
??? |
| P31 |
instance of |
... |
Q113145171 (type of chemical entity) |
type of chemical entity |
| P2017 |
isomeric SMILES |
String |
C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC(=C)C4=CC(=O)C=C[C@]34C |
??? |
| P8026 |
LiverTox likelihood score |
... |
Q83284310 (LiverTox toxicity likelihood category C) |
LiverTox toxicity likelihood category C |
| P1987 |
MCN code |
String |
3003.39.95 |
??? |
| P1987 |
MCN code |
String |
3004.39.94 |
??? |
| P2175 |
medical condition treated |
... |
Q128581 (breast cancer) |
breast cancer |
| P2175 |
medical condition treated |
... |
Q1671685 (invasive ductal carcinoma) |
invasive ductal carcinoma |
| P129 |
physically interacts with |
... |
Q415287 (cytochrome P450 family 19 subfamily A member 1) |
cytochrome P450 family 19 subfamily A member 1 |
| P3489 |
pregnancy category |
... |
Q28123618 (US pregnancy category D) |
US pregnancy category D |
| P279 |
subclass of |
... |
Q126676340 (6-Methylideneandrosta-1,4-diene-3,17-dione) |
6-Methylideneandrosta-1,4-diene-3,17-dione |
| P2868 |
subject has role |
... |
Q3040305 (aromatase inhibitors) |
aromatase inhibitors |
| P2868 |
subject has role |
... |
Q427492 (enzyme inhibitor) |
enzyme inhibitor |
| P2868 |
subject has role |
... |
Q2853144 (antineoplastic) |
antineoplastic |
| P2275 |
World Health Organisation international non-proprietary name |
Monolingualtext |
exemestane |
??? |
| P267 | ATC code | L02BG06 |
| P231 | CAS Registry Number | 107868-30-4 |
| P683 | ChEBI ID | 4953 |
| P592 | ChEMBL ID | CHEMBL1200374 |
| P661 | ChemSpider ID | 54278 |
| P715 | DrugBank ID | DB00990 |
| P11198 | DrugCentral ID | 1122 |
| P8494 | DSSTOX compound identifier | DTXCID003037 |
| P3117 | DSSTox substance ID | DTXSID5023037 |
| P232 | EC number | 643-090-2 |
| P2566 | ECHA Substance Infocard ID | 100.171.149 |
| P646 | Freebase ID | /m/08x0jh |
| P595 | Guide to Pharmacology Ligand ID | 7073 |
| P2062 | HSDB ID | 7463 |
| P2057 | Human Metabolome Database ID | HMDB0015125 |
| P234 | InChI | InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 |
| P235 | InChIKey | BFYIZQONLCFLEV-DAELLWKTSA-N |
| P665 | KEGG ID | C08162 |
| P665 | KEGG ID | D00963 |
| P7830 | LiverTox ID | Exemestane |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224201 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224202 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224203 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224204 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224205 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224207 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224230 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU224231 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066101 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066102 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066103 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066104 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066105 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066106 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066107 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066108 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066109 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066110 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066111 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066112 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066113 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EA066114 |
| P10245 | MedlinePlus drug identifier | a607006 |
| P486 | MeSH descriptor ID | C056516 |
| P6366 | Microsoft Academic ID (discontinued) | 2775860665 |
| P2115 | NDF-RT ID | N0000148637 |
| P2840 | NSC number | 758907 |
| P10283 | OpenAlex ID | C2775860665 |
| P4235 | PatientsLikeMe treatment ID | exemestane |
| P3636 | PDB ligand ID | EXM |
| P638 | PDB structure ID | 3S7S |
| P11199 | Probes And Drugs ID | PD003000 |
| P662 | PubChem CID | 60198 |
| P3417 | Quora topic ID | Exemestane-1 |
| P1579 | Reaxys registry number | 6609645 |
| P3345 | RxNorm CUI | 258494 |
| P4964 | SPLASH | splash10-0002-0090000000-8292cd5caa67529123d5 |
| P4964 | SPLASH | splash10-0002-0090000000-cc584f39a06f24401467 |
| P4964 | SPLASH | splash10-0002-0090000000-d372ca664e7a339d245e |
| P4964 | SPLASH | splash10-0002-0290000000-3017fa06837d687a9ed9 |
| P4964 | SPLASH | splash10-0002-0790000000-46727c37da42caccba4f |
| P4964 | SPLASH | splash10-0002-0950000000-0daf2c711395130c78a2 |
| P4964 | SPLASH | splash10-0002-1890000000-1fcf62ddeb8dd8441390 |
| P4964 | SPLASH | splash10-0002-1960000000-22b6bd7c2ccea9c0c648 |
| P4964 | SPLASH | splash10-0002-1970000000-6aca0caa93beac3bf271 |
| P4964 | SPLASH | splash10-004i-0890000000-43dff5a59fc535cf2f01 |
| P4964 | SPLASH | splash10-004i-0980000000-457e7fb9bd5073d9521a |
| P4964 | SPLASH | splash10-006t-0910000000-58ddee06caa2cdb4eeac |
| P4964 | SPLASH | splash10-006t-0910000000-64dd2bfc1eef30f5b766 |
| P4964 | SPLASH | splash10-006t-0930000000-70c14a429cc679c17e57 |
| P4964 | SPLASH | splash10-006w-2910000000-2f4bac4fb8744faeb793 |
| P4964 | SPLASH | splash10-00dj-0910000000-1483760a934897cf3b7a |
| P4964 | SPLASH | splash10-00dj-2910000000-32edf95f8027c36c74ce |
| P4964 | SPLASH | splash10-00wa-0900000000-ec533e47176e668d1ee9 |
| P4964 | SPLASH | splash10-014i-0009000000-0a3cc4550e16db4e3b05 |
| P4964 | SPLASH | splash10-054o-7900000000-d4fd55a1386141770feb |
| P4964 | SPLASH | splash10-054o-7900000000-e5ae5c87edd46bea9bdf |
| P4964 | SPLASH | splash10-0596-4900000000-3888c20b2af766bfbd28 |
| P4964 | SPLASH | splash10-0596-5900000000-f4ef5b1c0c3093d9be81 |
| P4964 | SPLASH | splash10-05fu-3900000000-84dacb108ccc2572ab41 |
| P4964 | SPLASH | splash10-05fu-3900000000-93e6d94ff92391e3ae17 |
| P2877 | SureChEMBL ID | 6215 |
| P2892 | UMLS CUI | C0851344 |
| P11089 | UniChem compound ID | 443709 |
| P652 | UNII | NY22HMQ4BX |
| P11143 | WikiProjectMed ID | Exemestane |