Wikidata entity: Q419401
C₆H₁₅ClN₂O₂ (P274)
Quantities
| P4250 | defined daily dose | 0.4 |
| P2067 | mass | 182.082 |
| P3780 | active ingredient in | ... | Q48828323 (Miostat) | Miostat |
| P233 | canonical SMILES | String | C[N+](C)(C)CCOC(=O)N.[Cl-] | ??? |
| P373 | Commons category | String | Carbachol | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q159701 (glaucoma) | glaucoma |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P279 | subclass of | ... | Q422899 (carbamate) | carbamate |
| P279 | subclass of | ... | Q44791900 (chloride) | chloride |
| P279 | subclass of | ... | Q72087444 (quaternary ammonium compound) | quaternary ammonium compound |
| P2868 | subject has role | ... | Q1293337 (miotic drugs) | miotic drugs |
| P2868 | subject has role | ... | Q1747785 (non-opioid analgesic) | non-opioid analgesic |
| P2868 | subject has role | ... | Q2938102 (cardiotonic) | cardiotonic |
| P2868 | subject has role | ... | Q50430232 (cholinergic agonist) | cholinergic agonist |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | carbachol | ??? |
| P267 | ATC code | B05XA04 |
| P267 | ATC code | N07AB01 |
| P267 | ATC code | S01EB02 |
| P8072 | CAB ID | 84090 |
| P11931 | CAMEO Chemicals ID | 4900 |
| P231 | CAS Registry Number | 51-83-2 |
| P683 | ChEBI ID | 3385 |
| P592 | ChEMBL ID | CHEMBL14 |
| P661 | ChemSpider ID | 5626 |
| P715 | DrugBank ID | DB00411 |
| P8494 | DSSTOX compound identifier | DTXCID502730 |
| P3117 | DSSTox substance ID | DTXSID9022730 |
| P232 | EC number | 200-127-3 |
| P2566 | ECHA Substance Infocard ID | 100.000.117 |
| P646 | Freebase ID | /m/037kkz |
| P2062 | HSDB ID | 6373 |
| P234 | InChI | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H |
| P235 | InChIKey | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| P8408 | KBpedia ID | Carbachol |
| P665 | KEGG ID | D00524 |
| P486 | MeSH descriptor ID | D002217 |
| P672 | MeSH tree code | D02.092.877.883.333.115 |
| P672 | MeSH tree code | D02.675.276.232.115 |
| P6366 | Microsoft Academic ID (discontinued) | 2778988552 |
| P2115 | NDF-RT ID | N0000146899 |
| P2840 | NSC number | 32865 |
| P2840 | NSC number | 755919 |
| P10283 | OpenAlex ID | C2778988552 |
| P3636 | PDB ligand ID | CCE |
| P638 | PDB structure ID | 7SMR |
| P11199 | Probes And Drugs ID | PD002446 |
| P662 | PubChem CID | 5831 |
| P662 | PubChem CID | 521353 |
| P1579 | Reaxys registry number | 3917459 |
| P3345 | RxNorm CUI | 1999 |
| P5082 | Store medisinske leksikon ID | karbakolin |
| P2877 | SureChEMBL ID | 2791 |
| P2892 | UMLS CUI | C0006945 |
| P695 | UN number | 2811 |
| P11089 | UniChem compound ID | 42560 |
| P652 | UNII | 8Y164V895Y |
| P11143 | WikiProjectMed ID | Carbachol |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 383 |
| P679 | ZVG number | 490046 |
Why not click here or view trends?
log id: 2842755