Wikidata entity: Q419468
C₁₂H₁₇NO₂ (P274)
Quantities
| P2067 | mass | 207.126 |
| P3780 | active ingredient in | ... | Q47521353 (Ciclodan) | Ciclodan |
| P3780 | active ingredient in | ... | Q48825982 (CNL8) | CNL8 |
| P3780 | active ingredient in | ... | Q48829189 (Penlac Nail Lacquer) | Penlac Nail Lacquer |
| P233 | canonical SMILES | String | CC1=CC(=O)N(C(=C1)C2CCCCC2)O | ??? |
| P373 | Commons category | String | Ciclopirox | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q448310 (seborrhoeic dermatitis) | seborrhoeic dermatitis |
| P2175 | medical condition treated | ... | Q917620 (onychomycosis) | onychomycosis |
| P2175 | medical condition treated | ... | Q926462 (pityriasis versicolor) | pityriasis versicolor |
| P2175 | medical condition treated | ... | Q5609817 (tinea pedis) | tinea pedis |
| P2175 | medical condition treated | ... | Q11581119 (cutaneous candidiasis) | cutaneous candidiasis |
| P2175 | medical condition treated | ... | Q17141201 (tinea) | tinea |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q578726 (antifungal) | antifungal |
| P2868 | subject has role | ... | Q4774456 (anti-seborrheic) | anti-seborrheic |
| P2868 | subject has role | ... | Q7251505 (protein synthesis inhibitor) | protein synthesis inhibitor |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | ciclopirox | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | سيكلوبيروكس | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | ciclopirox | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | ciclopirox | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | ciclopiroxum | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | циклопирокс | ??? |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | 环吡酮 | ??? |
| P267 | ATC code | D01AE14 |
| P267 | ATC code | G01AX12 |
| P8072 | CAB ID | 33423 |
| P231 | CAS Registry Number | 29342-05-0 |
| P683 | ChEBI ID | 453011 |
| P592 | ChEMBL ID | CHEMBL1413 |
| P661 | ChemSpider ID | 2647 |
| P9272 | DeCS ID | 57747 |
| P715 | DrugBank ID | DB01188 |
| P11198 | DrugCentral ID | 636 |
| P8494 | DSSTOX compound identifier | DTXCID2028193 |
| P3117 | DSSTox substance ID | DTXSID9048564 |
| P232 | EC number | 249-577-2 |
| P2566 | ECHA Substance Infocard ID | 100.045.056 |
| P646 | Freebase ID | /m/061gyg |
| P2057 | Human Metabolome Database ID | HMDB0015319 |
| P234 | InChI | InChI=1S/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3 |
| P235 | InChIKey | SCKYRAXSEDYPSA-UHFFFAOYSA-N |
| P665 | KEGG ID | D03488 |
| P244 | Library of Congress authority ID | sh98008066 |
| P10245 | MedlinePlus drug identifier | a604021 |
| P486 | MeSH descriptor ID | D000077768 |
| P672 | MeSH tree code | D02.455.426.392.368.367.095 |
| P672 | MeSH tree code | D03.383.725.791.199 |
| P6366 | Microsoft Academic ID (discontinued) | 2780791370 |
| P8189 | National Library of Israel J9U ID | 987007556413305171 |
| P2115 | NDF-RT ID | N0000147770 |
| P3636 | PDB ligand ID | B4O |
| P11199 | Probes And Drugs ID | PD003531 |
| P662 | PubChem CID | 2749 |
| P1579 | Reaxys registry number | 1533423 |
| P3345 | RxNorm CUI | 21090 |
| P2877 | SureChEMBL ID | 34424 |
| P2892 | UMLS CUI | C0055711 |
| P11089 | UniChem compound ID | 296301 |
| P652 | UNII | 19W019ZDRJ |
| P11143 | WikiProjectMed ID | Ciclopirox |
| P3471 | WikiSkripta article ID | 75084 |
Why not click here or view trends?
log id: 3235408