Wikidata entity: Q419626
C₂H₈N₂O₄ (P274)
Quantities
| P2067 | mass | 124.048 |
| P233 | canonical SMILES | String | C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+] | ??? |
| P373 | Commons category | String | Ammonium oxalate | ??? |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P1014 | Art & Architecture Thesaurus ID | 300380079 |
| P231 | CAS Registry Number | 1113-38-8 |
| P683 | ChEBI ID | 91241 |
| P661 | ChemSpider ID | 13577 |
| P11375 | CSD Refcode | MOYHAJ |
| P8494 | DSSTOX compound identifier | DTXCID501028696 |
| P3117 | DSSTox substance ID | DTXSID50889443 |
| P232 | EC number | 214-202-3 |
| P2566 | ECHA Substance Infocard ID | 100.012.912 |
| P646 | Freebase ID | /m/0gg4s3p |
| P7025 | HCIS ID | 5165 |
| P2062 | HSDB ID | 1424 |
| P5220 | ICSC ID | 1036 |
| P234 | InChI | InChI=1S/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3 |
| P235 | InChIKey | VBIXEXWLHSRNKB-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2780517195 |
| P10283 | OpenAlex ID | C2780517195 |
| P11949 | PesticideInfo chemical ID | PRI1224 |
| P662 | PubChem CID | 14213 |
| P662 | PubChem CID | 13531065 |
| P1579 | Reaxys registry number | 13274555 |
| P2877 | SureChEMBL ID | 36397 |
| P652 | UNII | 0PB8MO5U0H |
| P679 | ZVG number | 493891 |
Why not click here or view trends?
log id: 5841861