Wikidata entity: Q419944
C₉H₁₂ClN₅O (P274)
Quantities
| P4250 | defined daily dose | 0.3 |
| P2067 | mass | 241.073038 |
| P233 | canonical SMILES | String | CC1=NC(=C(C(=N1)Cl)NC2=NCCN2)OC | ??? |
| P373 | Commons category | String | Moxonidine | ??? |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P3489 | pregnancy category | ... | Q3679234 (Australian pregnancy category B3) | Australian pregnancy category B3 |
| P769 | significant drug interaction | ... | Q408556 (levobunolol) | levobunolol |
| P769 | significant drug interaction | ... | Q409468 ((RS)-metoprolol) | (RS)-metoprolol |
| P769 | significant drug interaction | ... | Q411325 (atenolol) | atenolol |
| P769 | significant drug interaction | ... | Q412515 (bisoprolol) | bisoprolol |
| P769 | significant drug interaction | ... | Q412534 (carvedilol) | carvedilol |
| P769 | significant drug interaction | ... | Q413591 (sotalol) | sotalol |
| P769 | significant drug interaction | ... | Q418101 (pindolol) | pindolol |
| P769 | significant drug interaction | ... | Q418130 (nebivolol) | nebivolol |
| P769 | significant drug interaction | ... | Q418857 (acebutolol) | acebutolol |
| P769 | significant drug interaction | ... | Q423364 (propranolol) | propranolol |
| P769 | significant drug interaction | ... | Q424952 (nadolol) | nadolol |
| P769 | significant drug interaction | ... | Q794162 (betaxolol) | betaxolol |
| P769 | significant drug interaction | ... | Q958087 (labetalol) | labetalol |
| P279 | subclass of | ... | Q193430 (heterocyclic compound) | heterocyclic compound |
| P2868 | subject has role | ... | Q575890 (antihypertensive drug) | antihypertensive drug |
| P267 | ATC code | C02AC05 |
| P231 | CAS Registry Number | 75438-57-2 |
| P683 | ChEBI ID | 7009 |
| P592 | ChEMBL ID | CHEMBL19236 |
| P661 | ChemSpider ID | 4645 |
| P715 | DrugBank ID | DB09242 |
| P11198 | DrugCentral ID | 1856 |
| P8494 | DSSTOX compound identifier | DTXCID3025170 |
| P3117 | DSSTox substance ID | DTXSID5045170 |
| P232 | EC number | 629-833-3 |
| P2566 | ECHA Substance Infocard ID | 100.158.061 |
| P646 | Freebase ID | /m/08g0xy |
| P2057 | Human Metabolome Database ID | HMDB0041938 |
| P234 | InChI | InChI=1S/C9H12ClN5O/c1-5-13-7(10)6(8(14-5)16-2)15-9-11-3-4-12-9/h3-4H2,1-2H3,(H2,11,12,15) |
| P235 | InChIKey | WPNJAUFVNXKLIM-UHFFFAOYSA-N |
| P665 | KEGG ID | C07451 |
| P665 | KEGG ID | D05087 |
| P486 | MeSH descriptor ID | C043482 |
| P6366 | Microsoft Academic ID (discontinued) | 2777014715 |
| P10283 | OpenAlex ID | C2777014715 |
| P11199 | Probes And Drugs ID | PD008988 |
| P662 | PubChem CID | 4810 |
| P3345 | RxNorm CUI | 30257 |
| P2877 | SureChEMBL ID | 49143 |
| P11089 | UniChem compound ID | 312373 |
| P652 | UNII | CC6X0L40GW |
Why not click here or view trends?
log id: 3053442