Wikidata entity: Q419987
C₈H₈N₄ (P274)
Quantities
| P4250 | defined daily dose | 0.1 |
| P2067 | mass | 160.075 |
| P233 | canonical SMILES | String | C1=CC=C2C(=C1)C=NN=C2NN | ??? |
| P373 | Commons category | String | Hydralazine | ??? |
| P1889 | different from | ... | Q58447 (hydrazine) | hydrazine |
| P703 | found in taxon | ... | Q15585450 (Achillea pseudopectinata) | Achillea pseudopectinata |
| P703 | found in taxon | ... | Q15586847 (Achillea odorata) | Achillea odorata |
| P703 | found in taxon | ... | Q87607851 (Achillea depressa) | Achillea depressa |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Hydralazine-3D-balls.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P8026 | LiverTox likelihood score | ... | Q83283320 (LiverTox toxicity likelihood category A) | LiverTox toxicity likelihood category A |
| P2175 | medical condition treated | ... | Q41861 (arterial hypertension) | arterial hypertension |
| P2175 | medical condition treated | ... | Q1128595 (pulmonary hypertension) | pulmonary hypertension |
| P2175 | medical condition treated | ... | Q1641132 (malignant hypertension) | malignant hypertension |
| P2175 | medical condition treated | ... | Q19000661 (congestive heart failure) | congestive heart failure |
| P3489 | pregnancy category | ... | Q3679261 (Australian pregnancy category C) | Australian pregnancy category C |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P9989 | stylized name | String | hydrALAZINE | ??? |
| P279 | subclass of | ... | Q70702 (alkaloid) | alkaloid |
| P2868 | subject has role | ... | Q35456 (essential medicine) | essential medicine |
| P2868 | subject has role | ... | Q575890 (antihypertensive drug) | antihypertensive drug |
| P2868 | subject has role | ... | Q4008956 (vasodilator agent) | vasodilator agent |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | hydralazine | ??? |
| P267 | ATC code | C02DB02 |
| P231 | CAS Registry Number | 86-54-4 |
| P683 | ChEBI ID | 5775 |
| P592 | ChEMBL ID | CHEMBL276832 |
| P661 | ChemSpider ID | 3511 |
| P9272 | DeCS ID | 6982 |
| P715 | DrugBank ID | DB01275 |
| P11198 | DrugCentral ID | 1384 |
| P8494 | DSSTOX compound identifier | DTXCID703129 |
| P3117 | DSSTox substance ID | DTXSID4023129 |
| P232 | EC number | 201-680-3 |
| P2566 | ECHA Substance Infocard ID | 100.001.528 |
| P9635 | electronic Essential Medicines List medicine ID | 138 |
| P1417 | Encyclopædia Britannica Online ID | topic/hydralazine |
| P646 | Freebase ID | /m/07jhn8 |
| P1578 | Gmelin number | 4337 |
| P595 | Guide to Pharmacology Ligand ID | 7326 |
| P2057 | Human Metabolome Database ID | HMDB0015400 |
| P4168 | IEDB Epitope ID | 137349 |
| P234 | InChI | InChI=1S/C8H8N4/c9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-5H,9H2,(H,11,12) |
| P235 | InChIKey | RPTUSVTUFVMDQK-UHFFFAOYSA-N |
| P665 | KEGG ID | C07040 |
| P665 | KEGG ID | D08044 |
| P7830 | LiverTox ID | Hydralazine |
| P6694 | MeSH concept ID | M0010676 |
| P486 | MeSH descriptor ID | D006830 |
| P672 | MeSH tree code | D03.383.710.605.500 |
| P6366 | Microsoft Academic ID (discontinued) | 2780521442 |
| P2115 | NDF-RT ID | N0000147869 |
| P9405 | NMRShiftDB structure ID | 20202075 |
| P2840 | NSC number | 126699 |
| P10283 | OpenAlex ID | C2780521442 |
| P3636 | PDB ligand ID | HLZ |
| P638 | PDB structure ID | 3LTW |
| P11199 | Probes And Drugs ID | PD009925 |
| P662 | PubChem CID | 3637 |
| P1579 | Reaxys registry number | 132615 |
| P3345 | RxNorm CUI | 5470 |
| P5076 | Römpp online ID | RD-08-02111 |
| P5082 | Store medisinske leksikon ID | hydralazin |
| P2877 | SureChEMBL ID | 7810 |
| P2877 | SureChEMBL ID | 6617758 |
| P2892 | UMLS CUI | C0020223 |
| P11089 | UniChem compound ID | 273238 |
| P652 | UNII | 26NAK24LS8 |
| P11143 | WikiProjectMed ID | Hydralazine |
| P8814 | WordNet 3.1 Synset ID | 03555851-n |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 1 |
Why not click here or view trends?
log id: 2113704