Wikidata entity: Q421138
C₁₅H₁₀BrClN₂O (P274)
Quantities
| P2067 | mass | 347.967 |
| P233 | canonical SMILES | String | C1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=C3Cl | ??? |
| P373 | Commons category | String | Phenazepam | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q576618 (anticonvulsant agent) | anticonvulsant agent |
| P2868 | subject has role | ... | Q967453 (immunologic adjuvant) | immunologic adjuvant |
| P2868 | subject has role | ... | Q50430239 (GABA agents) | GABA agents |
| P2868 | subject has role | ... | Q241549 (antiarrhythmic agent) | antiarrhythmic agent |
| P231 | CAS Registry Number | 51753-57-2 |
| P592 | ChEMBL ID | CHEMBL1709464 |
| P661 | ChemSpider ID | 36657 |
| P715 | DrugBank ID | DB19164 |
| P8494 | DSSTOX compound identifier | DTXCID60122176 |
| P3117 | DSSTox substance ID | DTXSID00199685 |
| P232 | EC number | 682-231-2 |
| P2566 | ECHA Substance Infocard ID | 100.207.405 |
| P646 | Freebase ID | /m/026wksq |
| P234 | InChI | InChI=1S/C15H10BrClN2O/c16-9-5-6-13-11(7-9)15(18-8-14(20)19-13)10-3-1-2-4-12(10)17/h1-7H,8H2,(H,19,20) |
| P235 | InChIKey | CGMJQQJSWIRRRL-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C017928 |
| P6366 | Microsoft Academic ID (discontinued) | 2779588025 |
| P11199 | Probes And Drugs ID | PD020116 |
| P662 | PubChem CID | 40113 |
| P3417 | Quora topic ID | Phenazepam |
| P10376 | ScienceDirect topic ID | medicine-and-dentistry/phenazepam |
| P10376 | ScienceDirect topic ID | pharmacology-toxicology-and-pharmaceutical-science/phenazepam |
| P2877 | SureChEMBL ID | 416137 |
| P11089 | UniChem compound ID | 1008729 |
| P652 | UNII | 3DSB43090Z |
Why not click here or view trends?
log id: 2163680