Wikidata entity: Q421304
C₁₀H₁₇N₃S (P274)
Quantities
| P4250 | defined daily dose | 2.5 |
| P2067 | mass | 211.114 |
| P3780 | active ingredient in | ... | Q47521840 (Mirapex) | Mirapex |
| P233 | canonical SMILES | String | CCCNC1CCC2=C(C1)SC(=N2)N | ??? |
| P373 | Commons category | String | Pramipexole | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Pramipexole%20ball-and-stick%20model.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCCN[C@H]1CCC2=C(C1)SC(=N2)N | ??? |
| P8026 | LiverTox likelihood score | ... | Q83284667 (LiverTox toxicity likelihood category E) | LiverTox toxicity likelihood category E |
| P2175 | medical condition treated | ... | Q11085 (Parkinson's disease) | Parkinson's disease |
| P2175 | medical condition treated | ... | Q916280 (restless legs syndrome) | restless legs syndrome |
| P2175 | medical condition treated | ... | Q19000444 (neurotic disorder) | neurotic disorder |
| P129 | physically interacts with | ... | Q2034004 (Dopamine receptor D2) | Dopamine receptor D2 |
| P129 | physically interacts with | ... | Q21110872 (Dopamine receptor D3) | Dopamine receptor D3 |
| P3489 | pregnancy category | ... | Q3679234 (Australian pregnancy category B3) | Australian pregnancy category B3 |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P769 | significant drug interaction | ... | Q422418 ((RS)-sulpiride) | (RS)-sulpiride |
| P3364 | stereoisomer of | ... | Q5268345 (dexpramipexole) | dexpramipexole |
| P279 | subclass of | ... | Q81977051 ((RS)-Pramipexole) | (RS)-Pramipexole |
| P2868 | subject has role | ... | Q600203 (dopamine agonist) | dopamine agonist |
| P2868 | subject has role | ... | Q3579672 (antiparkinson) | antiparkinson |
| P2868 | subject has role | ... | Q133948 (antioxidant) | antioxidant |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | pramipexole | ??? |
| P267 | ATC code | N04BC05 |
| P231 | CAS Registry Number | 104632-26-0 |
| P683 | ChEBI ID | 8356 |
| P592 | ChEMBL ID | CHEMBL301265 |
| P661 | ChemSpider ID | 106770 |
| P9272 | DeCS ID | 57660 |
| P715 | DrugBank ID | DB00413 |
| P11198 | DrugCentral ID | 2233 |
| P8494 | DSSTOX compound identifier | DTXCID203496 |
| P3117 | DSSTox substance ID | DTXSID6023496 |
| P232 | EC number | 600-593-1 |
| P2566 | ECHA Substance Infocard ID | 100.124.761 |
| P9635 | electronic Essential Medicines List medicine ID | 594 |
| P646 | Freebase ID | /m/0bb5jc |
| P595 | Guide to Pharmacology Ligand ID | 953 |
| P2062 | HSDB ID | 8253 |
| P2057 | Human Metabolome Database ID | HMDB0014557 |
| P234 | InChI | InChI=1S/C10H17N3S/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8/h7,12H,2-6H2,1H3,(H2,11,13)/t7-/m0/s1 |
| P235 | InChIKey | FASDKYOPVNHBLU-ZETCQYMHSA-N |
| P665 | KEGG ID | D05575 |
| P665 | KEGG ID | D00559 |
| P244 | Library of Congress authority ID | sh00001887 |
| P7830 | LiverTox ID | Pramipexole |
| P10245 | MedlinePlus drug identifier | a697029 |
| P486 | MeSH descriptor ID | D000077487 |
| P672 | MeSH tree code | D03.383.129.708.089.514 |
| P672 | MeSH tree code | D03.633.100.185.514 |
| P6366 | Microsoft Academic ID (discontinued) | 2779989193 |
| P8189 | National Library of Israel J9U ID | 987007285542805171 |
| P2115 | NDF-RT ID | N0000022076 |
| P2840 | NSC number | 760426 |
| P10283 | OpenAlex ID | C2779989193 |
| P4235 | PatientsLikeMe treatment ID | pramipexole |
| P11199 | Probes And Drugs ID | PD002907 |
| P662 | PubChem CID | 119570 |
| P3417 | Quora topic ID | Pramipexole |
| P1579 | Reaxys registry number | 6479326 |
| P3345 | RxNorm CUI | 746741 |
| P2877 | SureChEMBL ID | 35376 |
| P2892 | UMLS CUI | C0074710 |
| P11089 | UniChem compound ID | 435304 |
| P652 | UNII | 83619PEU5T |
| P11143 | WikiProjectMed ID | Pramipexole |
Why not click here or view trends?
log id: 2558317