Wikidata entity: Q421857
Al₂O₁₂S₃ (P274)
Quantities
| P2102 | boiling point | 1600 |
| P2107 | decomposition point | 580 |
| P2054 | density | 2.71031 |
| P2067 | mass | 341.818266 |
| P2101 | melting point | 700 |
| P233 | canonical SMILES | String | O=S1(=O)O[Al]2OS(=O)(=O)O[Al](O1)OS(=O)(=O)O2 | ??? |
| P373 | Commons category | String | Aluminium sulfate | ??? |
| P1889 | different from | ... | Q190527 (alum) | alum |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q663 (aluminium) | aluminium |
| P527 | has part(s) | ... | Q682 (sulfur) | sulfur |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P3493 | legal status (medicine) | ... | Q879952 (boxed warning) | boxed warning |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P1014 | Art & Architecture Thesaurus ID | 300387539 |
| P11931 | CAMEO Chemicals ID | 2394 |
| P231 | CAS Registry Number | 10043-01-3 |
| P683 | ChEBI ID | 74768 |
| P661 | ChemSpider ID | 23233 |
| P3073 | CosIng number | 31812 |
| P715 | DrugBank ID | DB11239 |
| P8494 | DSSTOX compound identifier | DTXCID0020317 |
| P3117 | DSSTox substance ID | DTXSID2040317 |
| P628 | E number | E520 |
| P232 | EC number | 233-135-0 |
| P2566 | ECHA Substance Infocard ID | 100.030.110 |
| P1417 | Encyclopædia Britannica Online ID | science/aluminum-sulfate |
| P646 | Freebase ID | /m/06gqpt |
| P227 | GND ID | 4329416-9 |
| P12385 | Gran Enciclopèdia Catalana ID | sulfat-dalumini |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0220805 |
| P9826 | Great Encyclopedia of Cyril and Methodius entry ID | Сульфат алюминия |
| P4342 | Great Norwegian Encyclopedia ID | aluminiumsulfat |
| P7025 | HCIS ID | 4904 |
| P2062 | HSDB ID | 5067 |
| P5220 | ICSC ID | 1191 |
| P234 | InChI | InChI=1S/2Al.3H2O4S/c;;3*1-5(2,3)4/h;;3*(H2,1,2,3,4)/q2*+3;;;/p-6 |
| P235 | InChIKey | DIZPMCHEQGEION-UHFFFAOYSA-H |
| P8408 | KBpedia ID | AluminumSulfate |
| P244 | Library of Congress authority ID | sh85004038 |
| P6366 | Microsoft Academic ID (discontinued) | 2779970790 |
| P6366 | Microsoft Academic ID (discontinued) | 2908901736 |
| P6366 | Microsoft Academic ID (discontinued) | 2909761612 |
| P2004 | NALT ID | 7275 |
| P8189 | National Library of Israel J9U ID | 987007294742005171 |
| P2840 | NSC number | 54563 |
| P10283 | OpenAlex ID | C2779970790 |
| P11949 | PesticideInfo chemical ID | PRI1166 |
| P10890 | PM20 ware ID | 141956 |
| P11199 | Probes And Drugs ID | PD057294 |
| P662 | PubChem CID | 24850 |
| P662 | PubChem CID | 75366293 |
| P662 | PubChem CID | 16694118 |
| P3417 | Quora topic ID | Aluminium-Sulfate |
| P3417 | Quora topic ID | Aluminum-Sulfate |
| P657 | RTECS number | BD1700000 |
| P3345 | RxNorm CUI | 1593147 |
| P5076 | Römpp online ID | RD-01-01826 |
| P2877 | SureChEMBL ID | 20219 |
| P2892 | UMLS CUI | C3853611 |
| P11089 | UniChem compound ID | 24448201 |
| P652 | UNII | I7T908772F |
| P13591 | Yale LUX ID | concept/21c8736e-9b95-408d-ab2f-1202ab010a91 |
| P679 | ZVG number | 2320 |
Why not click here or view trends?
log id: 7058526