| P233 |
canonical SMILES |
String |
CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
??? |
| P373 |
Commons category |
String |
Estradiol |
??? |
| P1889 |
different from |
... |
Q12415847 (17α/β-estradiol) |
17α/β-estradiol |
| P703 |
found in taxon |
... |
Q21120 (common starfish) |
common starfish |
| P703 |
found in taxon |
... |
Q148619 (Solanum glaucophyllum) |
Solanum glaucophyllum |
| P703 |
found in taxon |
... |
Q672531 (Daphnia magna) |
Daphnia magna |
| P703 |
found in taxon |
... |
Q1059580 (Locusta migratoria) |
Locusta migratoria |
| P703 |
found in taxon |
... |
Q1157813 (Dalbergia sissoo) |
Dalbergia sissoo |
| P703 |
found in taxon |
... |
Q7423609 (Sarcophaga bullata) |
Sarcophaga bullata |
| P703 |
found in taxon |
... |
Q15537103 (Onobrychis ebenoides) |
Onobrychis ebenoides |
| P703 |
found in taxon |
... |
Q15598040 (Iryanthera lancifolia) |
Iryanthera lancifolia |
| P703 |
found in taxon |
... |
Q15978631 (Homo sapiens) |
Homo sapiens |
| P527 |
has part(s) |
... |
Q623 (carbon) |
carbon |
| P366 |
has use |
... |
Q12140 (medication) |
medication |
| P8224 |
image of molecular model or crystal lattice model |
CommonsMedia |
http://commons.wikimedia.org/wiki/Special:FilePath/Oestradiol-3D-balls.png |
??? |
| P31 |
instance of |
... |
Q113145171 (type of chemical entity) |
type of chemical entity |
| P2017 |
isomeric SMILES |
String |
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O |
??? |
| P3493 |
legal status (medicine) |
... |
Q879952 (boxed warning) |
boxed warning |
| P2175 |
medical condition treated |
... |
Q128581 (breast cancer) |
breast cancer |
| P2175 |
medical condition treated |
... |
Q647630 (premature ovarian failure) |
premature ovarian failure |
| P2175 |
medical condition treated |
... |
Q938107 (hypogonadism) |
hypogonadism |
| P2175 |
medical condition treated |
... |
Q181257 (prostate cancer) |
prostate cancer |
| P2175 |
medical condition treated |
... |
Q7113244 (ovarian disease) |
ovarian disease |
| P2175 |
medical condition treated |
... |
Q22467774 (premature menopause) |
premature menopause |
| P361 |
part of |
... |
Q21117485 (17-beta-hydroxysteroid dehydrogenase (NAD+) activity) |
17-beta-hydroxysteroid dehydrogenase (NAD+) activity |
| P361 |
part of |
... |
Q22317068 (estradiol 6-beta-monooxygenase activity) |
estradiol 6-beta-monooxygenase activity |
| P129 |
physically interacts with |
... |
Q409867 (nuclear receptor subfamily 1 group I member 2) |
nuclear receptor subfamily 1 group I member 2 |
| P129 |
physically interacts with |
... |
Q5018799 (Potassium calcium-activated channel subfamily M alpha 1) |
Potassium calcium-activated channel subfamily M alpha 1 |
| P129 |
physically interacts with |
... |
Q5401857 (estrogen receptor 2) |
estrogen receptor 2 |
| P129 |
physically interacts with |
... |
Q5401858 (estrogen receptor 1) |
estrogen receptor 1 |
| P129 |
physically interacts with |
... |
Q5514257 (G protein-coupled estrogen receptor 1) |
G protein-coupled estrogen receptor 1 |
| P3364 |
stereoisomer of |
... |
Q4721888 (17α-estradiol) |
17α-estradiol |
| P3364 |
stereoisomer of |
... |
Q81988384 (ent-estradiol) |
ent-estradiol |
| P3364 |
stereoisomer of |
... |
Q105290526 (Dihydrofolliculin,(S)) |
Dihydrofolliculin,(S) |
| P3364 |
stereoisomer of |
... |
Q105290527 ((8R,9R,13S,14R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol) |
(8R,9R,13S,14R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| P3364 |
stereoisomer of |
... |
Q120355477 (8alpha-estra-1,3,5(10)-trien-3,17beta-diol) |
8alpha-estra-1,3,5(10)-trien-3,17beta-diol |
| P279 |
subclass of |
... |
Q12415847 (17α/β-estradiol) |
17α/β-estradiol |
| P2868 |
subject has role |
... |
Q187661 (carcinogen) |
carcinogen |
| P2868 |
subject has role |
... |
Q277954 (estrogen) |
estrogen |
| P2868 |
subject has role |
... |
Q3333419 (primary metabolite) |
primary metabolite |
| P910 |
topic's main category |
... |
Q55925794 (Category:Estradiol) |
Category:Estradiol |
| P267 | ATC code | G03CA03 |
| P268 | Bibliothèque nationale de France ID | 122583059 |
| P508 | BNCF Thesaurus ID | 57525 |
| P7524 | CA PROP 65 ID | estradiol-17b |
| P231 | CAS Registry Number | 50-28-2 |
| P683 | ChEBI ID | 16469 |
| P592 | ChEMBL ID | CHEMBL135 |
| P661 | ChemSpider ID | 5554 |
| P1036 | Dewey Decimal Classification | 615.366 |
| P1036 | Dewey Decimal Classification | 573.665374 |
| P1036 | Dewey Decimal Classification | 612.62 |
| P715 | DrugBank ID | DB00783 |
| P11198 | DrugCentral ID | 1057 |
| P8494 | DSSTOX compound identifier | DTXCID80573 |
| P3117 | DSSTox substance ID | DTXSID0020573 |
| P232 | EC number | 200-023-8 |
| P2566 | ECHA Substance Infocard ID | 100.000.022 |
| P646 | Freebase ID | /m/01h2ty |
| P1578 | Gmelin number | 290805 |
| P227 | GND ID | 4172466-5 |
| P12385 | Gran Enciclopèdia Catalana ID | estradiol |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0106664 |
| P2924 | Great Russian Encyclopedia Online ID (old version) | 4916502 |
| P595 | Guide to Pharmacology Ligand ID | 1013 |
| P595 | Guide to Pharmacology Ligand ID | 1012 |
| P2062 | HSDB ID | 3589 |
| P2057 | Human Metabolome Database ID | HMDB0000151 |
| P4168 | IEDB Epitope ID | 136018 |
| P234 | InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| P235 | InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N |
| P8408 | KBpedia ID | Estradiol |
| P665 | KEGG ID | D00105 |
| P2064 | KNApSAcK ID | C00058478 |
| P244 | Library of Congress authority ID | sh85045006 |
| P2063 | LIPID MAPS ID | LMST02010001 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP030301 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP030302 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP030303 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP030311 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP030312 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP030313 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP003433 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP004123 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP007247 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP009697 |
| P6689 | MassBank accession ID | MSBNK-UFZ-UF414901 |
| P6689 | MassBank accession ID | MSBNK-UFZ-UF414902 |
| P6689 | MassBank accession ID | MSBNK-UFZ-UF414903 |
| P6689 | MassBank accession ID | MSBNK-UFZ-UF414904 |
| P6694 | MeSH concept ID | M0007772 |
| P486 | MeSH descriptor ID | D004958 |
| P672 | MeSH tree code | D04.210.500.365.415.248 |
| P672 | MeSH tree code | D06.472.334.851.437.500 |
| P2004 | NALT ID | 38203 |
| P8189 | National Library of Israel J9U ID | 987007555683305171 |
| P950 | National Library of Spain SpMaBN ID (BNE v1.0) | XX549447 |
| P2085 | Nikkaji ID | J4.100I |
| P2840 | NSC number | 9895 |
| P2840 | NSC number | 756760 |
| P12594 | OSHA Occupational Chemical Database ID | 837 |
| P3636 | PDB ligand ID | EST |
| P638 | PDB structure ID | 1JGL |
| P638 | PDB structure ID | 4J24 |
| P638 | PDB structure ID | 4J26 |
| P638 | PDB structure ID | 4JVL |
| P638 | PDB structure ID | 5HYR |
| P638 | PDB structure ID | 3UUD |
| P638 | PDB structure ID | 1JNN |
| P638 | PDB structure ID | 2YJA |
| P638 | PDB structure ID | 1IOL |
| P638 | PDB structure ID | 2OCF |
| P638 | PDB structure ID | 4PXM |
| P638 | PDB structure ID | 1FDW |
| P638 | PDB structure ID | 1GWR |
| P638 | PDB structure ID | 1AQU |
| P638 | PDB structure ID | 5DX3 |
| P638 | PDB structure ID | 3OLL |
| P638 | PDB structure ID | 1ERE |
| P638 | PDB structure ID | 1LHU |
| P638 | PDB structure ID | 1FDU |
| P638 | PDB structure ID | 3OLS |
| P638 | PDB structure ID | 1PCG |
| P638 | PDB structure ID | 1QKU |
| P638 | PDB structure ID | 5DXG |
| P638 | PDB structure ID | 2D06 |
| P638 | PDB structure ID | 1E6W |
| P638 | PDB structure ID | 5DXE |
| P638 | PDB structure ID | 1QKT |
| P638 | PDB structure ID | 1A27 |
| P638 | PDB structure ID | 1FDS |
| P638 | PDB structure ID | 5DXB |
| P638 | PDB structure ID | 1A52 |
| P638 | PDB structure ID | 1FDT |
| P638 | PDB structure ID | 1G50 |
| P638 | PDB structure ID | 2J7X |
| P11199 | Probes And Drugs ID | PD002731 |
| P662 | PubChem CID | 5757 |
| P1579 | Reaxys registry number | 1914275 |
| P3345 | RxNorm CUI | 4083 |
| P5076 | Römpp online ID | RD-05-01825 |
| P10376 | ScienceDirect topic ID | medicine-and-dentistry/estradiol |
| P10376 | ScienceDirect topic ID | nursing-and-health-professions/estradiol |
| P10376 | ScienceDirect topic ID | psychology/estradiol |
| P10376 | ScienceDirect topic ID | veterinary-science-and-veterinary-medicine/estradiol |
| P10376 | ScienceDirect topic ID | agricultural-and-biological-sciences/estradiol |
| P10376 | ScienceDirect topic ID | biochemistry-genetics-and-molecular-biology/estradiol |
| P10376 | ScienceDirect topic ID | chemistry/estradiol |
| P4964 | SPLASH | splash10-0002-0960000000-2ad7c6e17386448419df |
| P4964 | SPLASH | splash10-0002-0960000000-d2ee002f4c0363c04e83 |
| P4964 | SPLASH | splash10-00di-0490000000-936f5006cf0be8e6c8bd |
| P4964 | SPLASH | splash10-00di-0790000000-5c858378c15135811824 |
| P4964 | SPLASH | splash10-00di-0960000000-be4e96105398cb805cd9 |
| P4964 | SPLASH | splash10-00di-3940000000-f3692a81f624f15d3e0b |
| P4964 | SPLASH | splash10-017r-1791100000-7b16254894cdcb8ee86d |
| P4964 | SPLASH | splash10-05fr-0590000000-1dd83cbcb3d21edfbdbd |
| P4964 | SPLASH | splash10-075a-2920000000-10218bfa5b56f829853e |
| P4964 | SPLASH | splash10-0a4i-1900000000-51d28e077b0aefa6aa1c |
| P4964 | SPLASH | splash10-0a4i-2900000000-a22a9233ffbb9eb05a1b |
| P4964 | SPLASH | splash10-0a4i-2900000000-f3279d6cdab9cf3800fd |
| P4964 | SPLASH | splash10-0a4i-8900000000-0efe28378f612aab8c3d |
| P2877 | SureChEMBL ID | 8049 |
| P8691 | SwissLipids ID | SLM:000001053 |
| P11089 | UniChem compound ID | 231287 |
| P652 | UNII | 4TI98Z838E |
| P11143 | WikiProjectMed ID | Estradiol |
| P3471 | WikiSkripta article ID | 69103 |
| P8814 | WordNet 3.1 Synset ID | 14774495-n |
| P13591 | Yale LUX ID | concept/4a83118e-a46c-4cbf-a221-273dc297775a |
| P2347 | YSO ID | 19425 |
