Wikidata entity: Q423401
C₆H₉NO₆ (P274)
Quantities
| P4250 | defined daily dose | 40 |
| P2067 | mass | 191.043 |
| P233 | canonical SMILES | String | C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O | ??? |
| P373 | Commons category | String | Isosorbide mononitrate | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1[C@@H]([C@@H]2[C@H](O1)[C@@H](CO2)O[N+](=O)[O-])O | ??? |
| P3364 | stereoisomer of | ... | Q27253548 (isosorbide 2-nitrate) | isosorbide 2-nitrate |
| P279 | subclass of | ... | Q49916468 (nitrate) | nitrate |
| P2868 | subject has role | ... | Q4008956 (vasodilator agent) | vasodilator agent |
| P2868 | subject has role | ... | Q50316227 (nitric oxide donors) | nitric oxide donors |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | isosorbide mononitrate | ??? |
| P267 | ATC code | C01DA14 |
| P11931 | CAMEO Chemicals ID | 19165 |
| P231 | CAS Registry Number | 16051-77-7 |
| P683 | ChEBI ID | 6062 |
| P592 | ChEMBL ID | CHEMBL1311 |
| P661 | ChemSpider ID | 25736 |
| P715 | DrugBank ID | DB01020 |
| P11198 | DrugCentral ID | 1506 |
| P8494 | DSSTOX compound identifier | DTXCID003176 |
| P3117 | DSSTox substance ID | DTXSID9023176 |
| P232 | EC number | 240-197-2 |
| P2566 | ECHA Substance Infocard ID | 100.036.527 |
| P646 | Freebase ID | /m/04b636 |
| P3720 | GPnotebook ID | 1516961817 |
| P595 | Guide to Pharmacology Ligand ID | 7052 |
| P2057 | Human Metabolome Database ID | HMDB0015155 |
| P234 | InChI | InChI=1S/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| P235 | InChIKey | YWXYYJSYQOXTPL-SLPGGIOYSA-N |
| P665 | KEGG ID | D00630 |
| P665 | KEGG ID | C07714 |
| P486 | MeSH descriptor ID | C030397 |
| P6366 | Microsoft Academic ID (discontinued) | 2778492647 |
| P2115 | NDF-RT ID | N0000148137 |
| P2840 | NSC number | 758619 |
| P10283 | OpenAlex ID | C2778492647 |
| P11199 | Probes And Drugs ID | PD000864 |
| P662 | PubChem CID | 27661 |
| P1579 | Reaxys registry number | 5851319 |
| P3345 | RxNorm CUI | 28004 |
| P2877 | SureChEMBL ID | 26781 |
| P2892 | UMLS CUI | C0064079 |
| P11089 | UniChem compound ID | 267840 |
| P652 | UNII | LX1OH63030 |
| P11143 | WikiProjectMed ID | Isosorbide mononitrate |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 5177 |
Why not click here or view trends?
log id: 4423183