Wikidata entity: Q423439
C₂₆H₃₄FNO₅ (P274)
Quantities
| P4250 | defined daily dose | 0.2 |
| P2067 | mass | 459.242101 |
| P233 | canonical SMILES | String | CC(C)C1=C(C(=C(C(=N1)C(C)C)C=CC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)COC | ??? |
| P373 | Commons category | String | Cerivastatin | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | COCC1=C(C2=CC=C(F)C=C2)C(\C=C\[C@@H](O)C[C@@H](O)CC(O)=O)=C(N=C1C(C)C)C(C)C | ??? |
| P2175 | medical condition treated | ... | Q184559 (arteriosclerosis) | arteriosclerosis |
| P2175 | medical condition treated | ... | Q844935 (coronary artery disease) | coronary artery disease |
| P2175 | medical condition treated | ... | Q1467339 (hypertriglyceridemia) | hypertriglyceridemia |
| P2175 | medical condition treated | ... | Q18554145 (familial hyperlipidemia) | familial hyperlipidemia |
| P1748 | NCI Thesaurus ID | String | C65308 | ??? |
| P129 | physically interacts with | ... | Q415607 (3-hydroxy-3-methylglutaryl-CoA reductase) | 3-hydroxy-3-methylglutaryl-CoA reductase |
| P3489 | pregnancy category | ... | Q3679274 (Australian pregnancy category D) | Australian pregnancy category D |
| P3364 | stereoisomer of | ... | Q27166543 ((3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxy-6-heptenoic acid) | (3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxy-6-heptenoic acid |
| P279 | subclass of | ... | Q134856 (carboxylic acid) | carboxylic acid |
| P2868 | subject has role | ... | Q954845 (statin) | statin |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | cerivastatin | ??? |
| P267 | ATC code | C10AA06 |
| P231 | CAS Registry Number | 145599-86-6 |
| P683 | ChEBI ID | 3558 |
| P592 | ChEMBL ID | CHEMBL1477 |
| P661 | ChemSpider ID | 393588 |
| P715 | DrugBank ID | DB00439 |
| P11198 | DrugCentral ID | 577 |
| P8494 | DSSTOX compound identifier | DTXCID402786 |
| P3117 | DSSTox substance ID | DTXSID9022786 |
| P646 | Freebase ID | /m/02z9d3 |
| P595 | Guide to Pharmacology Ligand ID | 2950 |
| P2062 | HSDB ID | 7357 |
| P234 | InChI | InChI=1S/C26H34FNO5/c1-15(2)25-21(11-10-19(29)12-20(30)13-23(31)32)24(17-6-8-18(27)9-7-17)22(14-33-5)26(28-25)16(3)4/h6-11,15-16,19-20,29-30H,12-14H2,1-5H3,(H,31,32)/b11-10+/t19-,20-/m1/s1 |
| P235 | InChIKey | SEERZIQQUAZTOL-ANMDKAQQSA-N |
| P665 | KEGG ID | C07966 |
| P665 | KEGG ID | D07661 |
| P486 | MeSH descriptor ID | C086276 |
| P6366 | Microsoft Academic ID (discontinued) | 2779415389 |
| P2115 | NDF-RT ID | N0000022124 |
| P10283 | OpenAlex ID | C2779415389 |
| P11199 | Probes And Drugs ID | PD009115 |
| P662 | PubChem CID | 446156 |
| P1579 | Reaxys registry number | 8366578 |
| P3345 | RxNorm CUI | 596723 |
| P2877 | SureChEMBL ID | 16346 |
| P2892 | UMLS CUI | C0528023 |
| P11089 | UniChem compound ID | 90837 |
| P652 | UNII | AM91H2KS67 |
| P8814 | WordNet 3.1 Synset ID | 03001816-n |
Why not click here or view trends?
log id: 9535747