Wikidata entity: Q424531
C₆H₈O₆ (P274)
Quantities
| P2067 | mass | 176.032 |
| P233 | canonical SMILES | String | C(C(C1C(=C(C(=O)O1)O)O)O)O | ??? |
| P373 | Commons category | String | Erythorbic acid | ??? |
| P1889 | different from | ... | Q193598 (DL-ascorbic acid) | DL-ascorbic acid |
| P703 | found in taxon | ... | Q1165686 (Grifola frondosa) | Grifola frondosa |
| P703 | found in taxon | ... | Q10530823 (Hypsizygus marmoreus) | Hypsizygus marmoreus |
| P703 | found in taxon | ... | Q372893 (Flammulina velutipes) | Flammulina velutipes |
| P703 | found in taxon | ... | Q843136 (Penicillium) | Penicillium |
| P703 | found in taxon | ... | Q104667425 (Hypsizigus marmoreus) | Hypsizigus marmoreus |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C([C@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O | ??? |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P3364 | stereoisomer of | ... | Q199678 (vitamin C) | vitamin C |
| P3364 | stereoisomer of | ... | Q27076988 (D-ascorbic acid) | D-ascorbic acid |
| P3364 | stereoisomer of | ... | Q27122608 (L-isoascorbic acid) | L-isoascorbic acid |
| P279 | subclass of | ... | Q108955625 (tetronic acid) | tetronic acid |
| P2868 | subject has role | ... | Q133948 (antioxidant) | antioxidant |
| P231 | CAS Registry Number | 89-65-6 |
| P683 | ChEBI ID | 51438 |
| P592 | ChEMBL ID | CHEMBL486293 |
| P661 | ChemSpider ID | 16736142 |
| P3073 | CosIng number | 33791 |
| P8494 | DSSTOX compound identifier | DTXCID306537 |
| P3117 | DSSTox substance ID | DTXSID6026537 |
| P628 | E number | E315 |
| P232 | EC number | 201-928-0 |
| P2566 | ECHA Substance Infocard ID | 100.001.753 |
| P646 | Freebase ID | /m/05lrsx |
| P2062 | HSDB ID | 584 |
| P234 | InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m1/s1 |
| P235 | InChIKey | CIWBSHSKHKDKBQ-DUZGATOHSA-N |
| P486 | MeSH descriptor ID | C005056 |
| P6366 | Microsoft Academic ID (discontinued) | 2780092807 |
| P6366 | Microsoft Academic ID (discontinued) | 2910296075 |
| P7746 | Natural Product Atlas ID | NPA007589 |
| P2840 | NSC number | 8117 |
| P1820 | Open Food Facts food additive ID | e315-erythorbic-acid |
| P3636 | PDB ligand ID | ISD |
| P638 | PDB structure ID | 2POQ |
| P638 | PDB structure ID | 5JCM |
| P11199 | Probes And Drugs ID | PD000091 |
| P662 | PubChem CID | 54675810 |
| P1579 | Reaxys registry number | 84271 |
| P3345 | RxNorm CUI | 1356145 |
| P5076 | Römpp online ID | RD-09-01459 |
| P2877 | SureChEMBL ID | 18678 |
| P11089 | UniChem compound ID | 652661 |
| P652 | UNII | 311332OII1 |
| P679 | ZVG number | 101014 |
Why not click here or view trends?
log id: 2521933