Wikidata entity: Q424551
C₆H₇NaO₆ (P274)

Quantities
| P2067 | mass | 198.014032 |
| P2101 | melting point | 218 |
| P233 | canonical SMILES | String | C(C(C1C(=C(C(=O)O1)O)[O-])O)O.[Na+] | ??? |
| P373 | Commons category | String | Sodium ascorbate | ??? |
| P527 | has part(s) | ... | Q658 (sodium) | sodium |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C([C@@H]([C@@H]1C(=C(C(=O)O1)O)[O-])O)O.[Na+] | ??? |
| P2175 | medical condition treated | ... | Q5445 (anemia) | anemia |
| P2175 | medical condition treated | ... | Q12125 (common cold) | common cold |
| P2175 | medical condition treated | ... | Q163865 (scurvy) | scurvy |
| P2175 | medical condition treated | ... | Q748442 (methemoglobinemia) | methemoglobinemia |
| P2175 | medical condition treated | ... | Q7162621 (penetrating trauma) | penetrating trauma |
| P2175 | medical condition treated | ... | Q7861692 (tyrosinemia type III) | tyrosinemia type III |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P3364 | stereoisomer of | ... | Q417003 (sodium erythorbate) | sodium erythorbate |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q15710532 (vitamer) | vitamer |
| P2868 | subject has role | ... | Q25401178 (free radical scavengers) | free radical scavengers |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | sodium ascorbate | ??? |
| P11931 | CAMEO Chemicals ID | 21012 |
| P231 | CAS Registry Number | 134-03-2 |
| P683 | ChEBI ID | 113451 |
| P592 | ChEMBL ID | CHEMBL591665 |
| P661 | ChemSpider ID | 16736174 |
| P3073 | CosIng number | 37729 |
| P715 | DrugBank ID | DB14482 |
| P8494 | DSSTOX compound identifier | DTXCID60105 |
| P3117 | DSSTox substance ID | DTXSID0020105 |
| P628 | E number | E301 |
| P232 | EC number | 205-126-1 |
| P2566 | ECHA Substance Infocard ID | 100.004.661 |
| P646 | Freebase ID | /m/06ztv_0 |
| P2062 | HSDB ID | 694 |
| P234 | InChI | InChI=1S/C6H8O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| P235 | InChIKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
| P665 | KEGG ID | D05853 |
| P6366 | Microsoft Academic ID (discontinued) | 2780247646 |
| P6366 | Microsoft Academic ID (discontinued) | 2910988363 |
| P2115 | NDF-RT ID | N0000145860 |
| P1820 | Open Food Facts food additive ID | e301-sodium-ascorbate |
| P5930 | Open Food Facts ingredient ID | sodium-ascorbate |
| P10283 | OpenAlex ID | C2780247646 |
| P11949 | PesticideInfo chemical ID | PRI5739 |
| P11199 | Probes And Drugs ID | PD052148 |
| P662 | PubChem CID | 23667548 |
| P662 | PubChem CID | 54685048 |
| P1579 | Reaxys registry number | 5465157 |
| P657 | RTECS number | CI7671000 |
| P3345 | RxNorm CUI | 267366 |
| P2877 | SureChEMBL ID | 3745 |
| P2892 | UMLS CUI | C0887557 |
| P11089 | UniChem compound ID | 397535 |
| P652 | UNII | S033EH8359 |
Why not click here or view trends?
log id: 3239329