Wikidata entity: Q425223
C₂₈H₂₇NO₄S (P274)
Quantities
| P4250 | defined daily dose | 60 |
| P2067 | mass | 473.166 |
| P2101 | melting point | 145 |
| P2993 | partition coefficient water/octanol | 5.2 |
| P2177 | solubility | 0.25 |
| P2177 | solubility | 1 |
| P2177 | solubility | 50 |
| P3780 | active ingredient in | ... | Q29005830 (Evista) | Evista |
| P233 | canonical SMILES | String | C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)O)C5=CC=C(C=C5)O | ??? |
| P373 | Commons category | String | Raloxifene | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P3493 | legal status (medicine) | ... | Q879952 (boxed warning) | boxed warning |
| P2175 | medical condition treated | ... | Q165328 (osteoporosis) | osteoporosis |
| P2175 | medical condition treated | ... | Q4941552 (bone disease) | bone disease |
| P129 | physically interacts with | ... | Q5401857 (estrogen receptor 2) | estrogen receptor 2 |
| P129 | physically interacts with | ... | Q5401858 (estrogen receptor 1) | estrogen receptor 1 |
| P3489 | pregnancy category | ... | Q3679561 (Australian pregnancy category X) | Australian pregnancy category X |
| P3489 | pregnancy category | ... | Q28123619 (US pregnancy category X) | US pregnancy category X |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q903917 (selective estrogen-receptor modulators) | selective estrogen-receptor modulators |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | raloxifene | ??? |
| P267 | ATC code | G03XC01 |
| P231 | CAS Registry Number | 84449-90-1 |
| P683 | ChEBI ID | 8772 |
| P592 | ChEMBL ID | CHEMBL81 |
| P661 | ChemSpider ID | 4859 |
| P715 | DrugBank ID | DB00481 |
| P11198 | DrugCentral ID | 2351 |
| P8494 | DSSTOX compound identifier | DTXCID803550 |
| P3117 | DSSTox substance ID | DTXSID3023550 |
| P232 | EC number | 686-786-1 |
| P2566 | ECHA Substance Infocard ID | 100.212.655 |
| P1417 | Encyclopædia Britannica Online ID | topic/raloxifene |
| P646 | Freebase ID | /m/060jym |
| P595 | Guide to Pharmacology Ligand ID | 2820 |
| P2062 | HSDB ID | 7460 |
| P2057 | Human Metabolome Database ID | HMDB0014624 |
| P234 | InChI | InChI=1S/C28H27NO4S/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29/h4-13,18,30-31H,1-3,14-17H2 |
| P235 | InChIKey | GZUITABIAKMVPG-UHFFFAOYSA-N |
| P665 | KEGG ID | C07228 |
| P665 | KEGG ID | D08465 |
| P244 | Library of Congress authority ID | sh00009274 |
| P6689 | MassBank accession ID | SM853603 |
| P6689 | MassBank accession ID | SM853653 |
| P10245 | MedlinePlus drug identifier | a698007 |
| P6694 | MeSH concept ID | M0112968 |
| P6366 | Microsoft Academic ID (discontinued) | 2779889926 |
| P8189 | National Library of Israel J9U ID | 987007293874205171 |
| P2115 | NDF-RT ID | N0000022103 |
| P2840 | NSC number | 747974 |
| P10283 | OpenAlex ID | C2779889926 |
| P3636 | PDB ligand ID | RAL |
| P638 | PDB structure ID | 1ERR |
| P638 | PDB structure ID | 2Y05 |
| P638 | PDB structure ID | 2JFA |
| P638 | PDB structure ID | 2QXS |
| P638 | PDB structure ID | 1QKN |
| P11199 | Probes And Drugs ID | PD004108 |
| P662 | PubChem CID | 5035 |
| P1579 | Reaxys registry number | 4890356 |
| P3345 | RxNorm CUI | 72143 |
| P5076 | Römpp online ID | RD-18-00203 |
| P4964 | SPLASH | splash10-0229-0035900000-dcf0b4afb1abd2691c7c |
| P2877 | SureChEMBL ID | 6144 |
| P4527 | UK Parliament thesaurus ID | 415057 |
| P2892 | UMLS CUI | C0244404 |
| P11089 | UniChem compound ID | 490723 |
| P652 | UNII | YX9162EO3I |
| P11143 | WikiProjectMed ID | Raloxifene |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 5388 |
| P2347 | YSO ID | 1709 |
Why not click here or view trends?
log id: 3717603