Wikidata entity: Q425911
C₁₀H₂₁NO₄ (P274)
Quantities
| P4250 | defined daily dose | 0.3 |
| P2067 | mass | 219.147 |
| P3780 | active ingredient in | ... | Q29006720 (Zavesca) | Zavesca |
| P233 | canonical SMILES | String | CCCCN1CC(C(C(C1CO)O)O)O | ??? |
| P373 | Commons category | String | Miglustat | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCCCN1C[C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O | ??? |
| P8026 | LiverTox likelihood score | ... | Q83284667 (LiverTox toxicity likelihood category E) | LiverTox toxicity likelihood category E |
| P2175 | medical condition treated | ... | Q861645 (Gaucher's disease) | Gaucher's disease |
| P129 | physically interacts with | ... | Q22678664 (UDP-glucose ceramide glucosyltransferase) | UDP-glucose ceramide glucosyltransferase |
| P3489 | pregnancy category | ... | Q28123619 (US pregnancy category X) | US pregnancy category X |
| P6802 | related image | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Miglustat-enzyme%20complex.png | ??? |
| P3364 | stereoisomer of | ... | Q27279309 (lucerastat) | lucerastat |
| P9989 | stylized name | String | migLUstat | ??? |
| P279 | subclass of | ... | Q126676385 (1-Butyl-2-(hydroxymethyl)piperidine-3,4,5-triol) | 1-Butyl-2-(hydroxymethyl)piperidine-3,4,5-triol |
| P2868 | subject has role | ... | Q427492 (enzyme inhibitor) | enzyme inhibitor |
| P2868 | subject has role | ... | Q50377208 (anti-HIV agents) | anti-HIV agents |
| P2868 | subject has role | ... | Q50430474 (glycoside hydrolase inhibitors) | glycoside hydrolase inhibitors |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | miglustat | ??? |
| P267 | ATC code | A16AX06 |
| P231 | CAS Registry Number | 72599-27-0 |
| P683 | ChEBI ID | 50381 |
| P592 | ChEMBL ID | CHEMBL1029 |
| P661 | ChemSpider ID | 46764 |
| P715 | DrugBank ID | DB00419 |
| P11198 | DrugCentral ID | 1807 |
| P8494 | DSSTOX compound identifier | DTXCID4025618 |
| P3117 | DSSTox substance ID | DTXSID6045618 |
| P232 | EC number | 689-232-7 |
| P2566 | ECHA Substance Infocard ID | 100.216.074 |
| P646 | Freebase ID | /m/02w57mz |
| P595 | Guide to Pharmacology Ligand ID | 4841 |
| P2057 | Human Metabolome Database ID | HMDB0014563 |
| P234 | InChI | InChI=1S/C10H21NO4/c1-2-3-4-11-5-8(13)10(15)9(14)7(11)6-12/h7-10,12-15H,2-6H2,1H3/t7-,8+,9-,10-/m1/s1 |
| P235 | InChIKey | UQRORFVVSGFNRO-UTINFBMNSA-N |
| P665 | KEGG ID | D05032 |
| P7830 | LiverTox ID | Miglustat |
| P10245 | MedlinePlus drug identifier | a604015 |
| P486 | MeSH descriptor ID | C059896 |
| P6366 | Microsoft Academic ID (discontinued) | 2778358581 |
| P2115 | NDF-RT ID | N0000148822 |
| P3636 | PDB ligand ID | NBV |
| P638 | PDB structure ID | 2V3D |
| P638 | PDB structure ID | 5IEF |
| P11199 | Probes And Drugs ID | PD010037 |
| P662 | PubChem CID | 51634 |
| P1579 | Reaxys registry number | 5862029 |
| P3345 | RxNorm CUI | 402316 |
| P10376 | ScienceDirect topic ID | chemistry/miglustat |
| P2877 | SureChEMBL ID | 246893 |
| P2892 | UMLS CUI | C1321596 |
| P11089 | UniChem compound ID | 359777 |
| P652 | UNII | ADN3S497AZ |
| P11143 | WikiProjectMed ID | Miglustat |
Why not click here or view trends?
log id: 5208686