Wikidata entity: Q426852
C₂₀H₃₀O₃ (P274)
Quantities
| P2067 | mass | 318.219 |
| P233 | canonical SMILES | String | CC12CCCC(C1CCC34C2CCC(C3)(C(=C)C4)O)(C)C(=O)O | ??? |
| P373 | Commons category | String | Steviol | ??? |
| P703 | found in taxon | ... | Q25400 (Asteraceae) | Asteraceae |
| P703 | found in taxon | ... | Q5339301 (Cucurbita) | Cucurbita |
| P703 | found in taxon | ... | Q7213452 (candyleaf) | candyleaf |
| P703 | found in taxon | ... | Q14847254 (Compositae) | Compositae |
| P703 | found in taxon | ... | Q104247011 (Bruguiera gymnorrhiza) | Bruguiera gymnorrhiza |
| P703 | found in taxon | ... | Q15386544 (Bruguiera gymnorhiza) | Bruguiera gymnorhiza |
| P703 | found in taxon | ... | Q15388741 (Ceriops decandra) | Ceriops decandra |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Steviol3d.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@@]12CCC[C@@]([C@H]1CC[C@]34[C@H]2CC[C@](C3)(C(=C)C4)O)(C)C(=O)O | ??? |
| P279 | subclass of | ... | Q108407223 (kaurane diterpenoid) | kaurane diterpenoid |
| P231 | CAS Registry Number | 471-80-7 |
| P683 | ChEBI ID | 145024 |
| P592 | ChEMBL ID | CHEMBL463996 |
| P661 | ChemSpider ID | 398979 |
| P8494 | DSSTOX compound identifier | DTXCID401326770 |
| P3117 | DSSTox substance ID | DTXSID50897427 |
| P646 | Freebase ID | /m/0h7nndy |
| P234 | InChI | InChI=1S/C20H30O3/c1-13-11-19-9-5-14-17(2,7-4-8-18(14,3)16(21)22)15(19)6-10-20(13,23)12-19/h14-15,23H,1,4-12H2,2-3H3,(H,21,22)/t14-,15-,17+,18+,19+,20-/m0/s1 |
| P235 | InChIKey | QFVOYBUQQBFCRH-VQSWZGCSSA-N |
| P2063 | LIPID MAPS ID | LMPR01040120 |
| P6366 | Microsoft Academic ID (discontinued) | 2780365743 |
| P2840 | NSC number | 226902 |
| P10283 | OpenAlex ID | C2780365743 |
| P11199 | Probes And Drugs ID | PD014855 |
| P662 | PubChem CID | 452967 |
| P3345 | RxNorm CUI | 1363645 |
| P5076 | Römpp online ID | RD-19-04071 |
| P2877 | SureChEMBL ID | 28608 |
| P2892 | UMLS CUI | C0075245 |
| P11089 | UniChem compound ID | 454948 |
| P652 | UNII | 4741LYX6RT |
Why not click here or view trends?
log id: 5898950