Wikidata entity: Q4363230
C₁₆H₁₉N₅O (P274)
Quantities
| P2067 | mass | 297.159 |
| P233 | canonical SMILES | String | CN1CCN(CC1)C2=NN=C3C(=C2)N(C4=CC=CC=C4O3)C | ??? |
| P373 | Commons category | String | Pipofezine | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q4340209 (depression) | depression |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 24886-52-0 |
| P592 | ChEMBL ID | CHEMBL1886755 |
| P661 | ChemSpider ID | 140640 |
| P8494 | DSSTOX compound identifier | DTXCID3026271 |
| P3117 | DSSTox substance ID | DTXSID5046271 |
| P646 | Freebase ID | /m/0bbz6bl |
| P234 | InChI | InChI=1S/C16H19N5O/c1-19-7-9-21(10-8-19)15-11-13-16(18-17-15)22-14-6-4-3-5-12(14)20(13)2/h3-6,11H,7-10H2,1-2H3 |
| P235 | InChIKey | SDYYIRPAZHJOLM-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2780384016 |
| P11199 | Probes And Drugs ID | PD014351 |
| P662 | PubChem CID | 159977 |
| P2877 | SureChEMBL ID | 366226 |
| P11089 | UniChem compound ID | 1125457 |
| P652 | UNII | P8T739L1FA |
Why not click here or view trends?
log id: 6061690