Wikidata entity: Q4545793
C₁₂H₁₄N₂O₂ (P274)
Quantities
| P2067 | mass | 218.105528 |
| P233 | canonical SMILES | String | CN1C=C(C2=CC=CC=C21)CC(C(=O)O)N | ??? |
| P703 | found in taxon | ... | Q134359 (Aspergillus fumigatus) | Aspergillus fumigatus |
| P31 | instance of | ... | Q15711994 (group of isomeric entities) | group of isomeric entities |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 26988-72-7 |
| P683 | ChEBI ID | 72821 |
| P592 | ChEMBL ID | CHEMBL513172 |
| P661 | ChemSpider ID | 88584 |
| P3117 | DSSTox substance ID | DTXSID601314131 |
| P232 | EC number | 248-157-6 |
| P2566 | ECHA Substance Infocard ID | 100.043.765 |
| P646 | Freebase ID | /m/0g5s7x8 |
| P595 | Guide to Pharmacology Ligand ID | 4694 |
| P2057 | Human Metabolome Database ID | HMDB0243932 |
| P234 | InChI | InChI=1S/C12H14N2O2/c1-14-7-8(6-10(13)12(15)16)9-4-2-3-5-11(9)14/h2-5,7,10H,6,13H2,1H3,(H,15,16) |
| P235 | InChIKey | ZADWXFSZEAPBJS-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2780260841 |
| P2840 | NSC number | 721300 |
| P11199 | Probes And Drugs ID | PD051322 |
| P662 | PubChem CID | 98112 |
| P1579 | Reaxys registry number | 20071 |
| P10376 | ScienceDirect topic ID | chemistry/1-methyltryptophan |
| P2877 | SureChEMBL ID | 19992 |
| P2877 | SureChEMBL ID | 14202956 |
| P11089 | UniChem compound ID | 536337 |
Why not click here or view trends?
log id: 5880105