Wikidata entity: Q4596857
C₁₄H₁₆BNO (P274)
Quantities
| P2067 | mass | 225.132495 |
| P2101 | melting point | 189 |
| P233 | canonical SMILES | String | B(C1=CC=CC=C1)(C2=CC=CC=C2)OCCN | ??? |
| P373 | Commons category | String | 2-Aminoethoxydiphenyl borate | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q7671479 (Transient receptor potential cation channel subfamily M member 3) | Transient receptor potential cation channel subfamily M member 3 |
| P129 | physically interacts with | ... | Q14891582 (Transient receptor potential cation channel subfamily V member 6) | Transient receptor potential cation channel subfamily V member 6 |
| P129 | physically interacts with | ... | Q14908176 (Transient receptor potential cation channel, subfamily V, member 1) | Transient receptor potential cation channel, subfamily V, member 1 |
| P129 | physically interacts with | ... | Q14914570 (Transient receptor potential cation channel subfamily M member 6) | Transient receptor potential cation channel subfamily M member 6 |
| P129 | physically interacts with | ... | Q15323688 (Transient receptor potential cation channel, subfamily V, member 2) | Transient receptor potential cation channel, subfamily V, member 2 |
| P129 | physically interacts with | ... | Q15324415 (Transient receptor potential cation channel, subfamily M, member 8) | Transient receptor potential cation channel, subfamily M, member 8 |
| P129 | physically interacts with | ... | Q15324694 (Transient receptor potential cation channel, subfamily V, member 3) | Transient receptor potential cation channel, subfamily V, member 3 |
| P129 | physically interacts with | ... | Q15327635 (Transient receptor potential cation channel, subfamily M, member 7) | Transient receptor potential cation channel, subfamily M, member 7 |
| P129 | physically interacts with | ... | Q21980258 (Transient receptor potential cation channel, subfamily C, member 2) | Transient receptor potential cation channel, subfamily C, member 2 |
| P129 | physically interacts with | ... | Q413209 (Transient receptor potential cation channel subfamily V member 1) | Transient receptor potential cation channel subfamily V member 1 |
| P129 | physically interacts with | ... | Q7671460 (Transient receptor potential cation channel subfamily C member 1) | Transient receptor potential cation channel subfamily C member 1 |
| P129 | physically interacts with | ... | Q7671461 (Transient receptor potential cation channel subfamily C member 3) | Transient receptor potential cation channel subfamily C member 3 |
| P129 | physically interacts with | ... | Q7671464 (Transient receptor potential cation channel subfamily C member 4) | Transient receptor potential cation channel subfamily C member 4 |
| P129 | physically interacts with | ... | Q7671468 (Transient receptor potential cation channel subfamily C member 5) | Transient receptor potential cation channel subfamily C member 5 |
| P129 | physically interacts with | ... | Q7671469 (Transient receptor potential cation channel subfamily C member 6) | Transient receptor potential cation channel subfamily C member 6 |
| P129 | physically interacts with | ... | Q7671473 (Transient receptor potential cation channel subfamily C member 7) | Transient receptor potential cation channel subfamily C member 7 |
| P129 | physically interacts with | ... | Q7671477 (Transient receptor potential cation channel subfamily M member 2) | Transient receptor potential cation channel subfamily M member 2 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 524-95-8 |
| P683 | ChEBI ID | 131184 |
| P592 | ChEMBL ID | CHEMBL169233 |
| P661 | ChemSpider ID | 1540 |
| P8494 | DSSTOX compound identifier | DTXCID8020389 |
| P3117 | DSSTox substance ID | DTXSID0040389 |
| P232 | EC number | 208-366-5 |
| P2566 | ECHA Substance Infocard ID | 100.007.607 |
| P646 | Freebase ID | /m/02vn3w9 |
| P595 | Guide to Pharmacology Ligand ID | 2433 |
| P234 | InChI | InChI=1S/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| P235 | InChIKey | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| P665 | KEGG ID | C20698 |
| P2085 | Nikkaji ID | J42.786A |
| P2840 | NSC number | 17107 |
| P3636 | PDB ligand ID | FZ4 |
| P11199 | Probes And Drugs ID | PD000617 |
| P662 | PubChem CID | 1598 |
| P1579 | Reaxys registry number | 2942273 |
| P2877 | SureChEMBL ID | 341835 |
| P11089 | UniChem compound ID | 421507 |
| P652 | UNII | E4ES684O93 |
Why not click here or view trends?
log id: 2830116