Wikidata entity: Q4596865
C₂₀H₂₄BrN₃O (P274)
Quantities
| P2067 | mass | 401.110275 |
| P233 | canonical SMILES | String | CCN(CC)C(=O)C1CN(C2CC3=C(NC4=CC=CC(=C34)C2=C1)Br)C | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCN(CC)C(=O)[C@H]1CN([C@@H]2CC3=C(NC4=CC=CC(=C34)C2=C1)Br)C | ??? |
| P129 | physically interacts with | ... | Q21109355 (5-hydroxytryptamine receptor 7) | 5-hydroxytryptamine receptor 7 |
| P129 | physically interacts with | ... | Q21497939 (5-hydroxytryptamine (serotonin) receptor 7) | 5-hydroxytryptamine (serotonin) receptor 7 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 478-84-2 |
| P592 | ChEMBL ID | CHEMBL274384 |
| P661 | ChemSpider ID | 9765 |
| P8494 | DSSTOX compound identifier | DTXCID101016542 |
| P3117 | DSSTox substance ID | DTXSID30878496 |
| P646 | Freebase ID | /m/0h541zg |
| P595 | Guide to Pharmacology Ligand ID | 272 |
| P234 | InChI | InChI=1S/C20H24BrN3O/c1-4-24(5-2)20(25)12-9-14-13-7-6-8-16-18(13)15(19(21)22-16)10-17(14)23(3)11-12/h6-9,12,17,22H,4-5,10-11H2,1-3H3/t12-,17-/m1/s1 |
| P235 | InChIKey | VKRAXSZEDRWLAG-SJKOYZFVSA-N |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP003738 |
| P6366 | Microsoft Academic ID (discontinued) | 2780091101 |
| P3636 | PDB ligand ID | A1AFU |
| P11199 | Probes And Drugs ID | PD052069 |
| P662 | PubChem CID | 10171 |
| P4964 | SPLASH | splash10-0udi-1294600000-3445c04104c6abbd3806 |
| P2877 | SureChEMBL ID | 1883414 |
| P11089 | UniChem compound ID | 68318 |
| P652 | UNII | JUA77QEU32 |
Why not click here or view trends?
log id: 1952898