Wikidata entity: Q4637164
C₁₃H₁₈N₂O (P274)
Quantities
| P2067 | mass | 218.142 |
| P233 | canonical SMILES | String | CN(C)CCC1=CNC2=C1C(=CC=C2)OC | ??? |
| P373 | Commons category | String | 4-MeO-DMT | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q66589878 (tryptamine alkaloid) | tryptamine alkaloid |
| P231 | CAS Registry Number | 3965-97-7 |
| P592 | ChEMBL ID | CHEMBL32029 |
| P661 | ChemSpider ID | 23126449 |
| P8494 | DSSTOX compound identifier | DTXCID60426702 |
| P3117 | DSSTox substance ID | DTXSID20475892 |
| P646 | Freebase ID | /m/0c03dyj |
| P234 | InChI | InChI=1S/C13H18N2O/c1-15(2)8-7-10-9-14-11-5-4-6-12(16-3)13(10)11/h4-6,9,14H,7-8H2,1-3H3 |
| P235 | InChIKey | HFYHBTWTJDAYGW-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD019779 |
| P662 | PubChem CID | 12017578 |
| P2877 | SureChEMBL ID | 19235737 |
| P11089 | UniChem compound ID | 148323 |
| P652 | UNII | X4NBI2F334 |
Why not click here or view trends?
log id: 4439071